CAS 30462-35-2
:Theaflavin 3
Description:
Theaflavin 3, with the CAS number 30462-35-2, is a polyphenolic compound primarily found in black tea. It is one of the key theaflavins formed during the oxidation of catechins in tea leaves. Theaflavin 3 is characterized by its antioxidant properties, which contribute to various health benefits, including potential anti-inflammatory and anti-cancer effects. This compound exhibits a yellow to orange color, which is typical of theaflavins, and it plays a significant role in the flavor and color profile of brewed black tea. Theaflavin 3, like other theaflavins, is soluble in water and has a relatively stable structure, allowing it to maintain its properties during the brewing process. Its presence in tea not only enhances the beverage's sensory attributes but also contributes to its nutritional value. Research continues to explore the various biological activities of theaflavins, including their effects on cardiovascular health and metabolic processes.
Formula:C43H32O20
InChI:InChI=1S/C43H32O20/c44-17-7-23(46)21-12-33(62-42(58)15-3-25(48)36(54)26(49)4-15)40(60-31(21)9-17)14-1-19-20(11-30(53)39(57)35(19)38(56)29(52)2-14)41-34(13-22-24(47)8-18(45)10-32(22)61-41)63-43(59)16-5-27(50)37(55)28(51)6-16/h1-11,33-34,40-41,44-51,53-55,57H,12-13H2,(H,52,56)/t33-,34-,40-,41-/m1/s1
InChI key:InChIKey=ZEASWHWETFMWCV-ISBUVJFSSA-N
SMILES:O(C(=O)C1=CC(O)=C(O)C(O)=C1)[C@H]2[C@@H](C3=C4C(=C(O)C(O)=C3)C(=O)C(O)=CC(=C4)[C@@H]5[C@H](OC(=O)C6=CC(O)=C(O)C(O)=C6)CC=7C(O5)=CC(O)=CC7O)OC=8C(C2)=C(O)C=C(O)C8
Synonyms:- 3,4,5-Trihydroxybenzoic acid (3,4,6-trihydroxy-5-oxo-5H-benzocycloheptene-1,8-diyl)bis[(2R,3R)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-2,3-diyl] ester
- Benzoic acid, 3,4,5-trihydroxy-, (3,4,6-trihydroxy-5-oxo-5H-benzocycloheptene-1,8-diyl)bis(3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-2,3-diyl) ester, [2R-[2α(2R*,3R*),3α]]-
- Benzoic acid, 3,4,5-trihydroxy-, (3,4,6-trihydroxy-5-oxo-5H-benzocycloheptene-1,8-diyl)bis[(2R,3R)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-2,3-diyl] ester
- Benzoic acid, 3,4,5-trihydroxy-, 1,1′-[(3,4,6-trihydroxy-5-oxo-5H-benzocycloheptene-1,8-diyl)bis[(2R,3R)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-2,3-diyl]] ester
- Theaflavin 3,3'-di-O-gallate
- Theaflavin 3,3′-digallate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Theaflavin 3,3'-digallate
CAS:Theaflavin-3,3'-digallate(TF3), an inducer of oxidative stress, which has anti-inflammatory and cancer chemopreventive actions, it reduces tumor angiogenesis by downregulating HIF-1αand VEGF; suggests that TF3 might serve as a potential anti-angiogenic agent for cancer treatment. TF3 and lactic acid combinations can reduce Herpes Simplex Virus(HSV) infectivity.Formula:C43H32O20Purity:95%~99%Molecular weight:868.709Theaflavin 3,3′-digallate
CAS:Theaflavin 3,3'-digallate, a major polyphenol found in black tea, is an inducer of oxidative stress which has anti-inflammatory and cancerFormula:C43H32O20Purity:98.71% - 99.86%Color and Shape:SolidMolecular weight:868.70Ref: TM-T5429
1mg87.00€5mg169.00€10mg268.00€1mL*10mM (DMSO)268.00€25mg462.00€50mg647.00€100mg873.00€200mg1,153.00€Theaflavin 3,3'-digallate
CAS:Oxygen-heterocyclic compoundFormula:C43H32O20Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:868.72Theaflavin-3,3'-digallate
CAS:Theaflavin-3,3'-digallate is a polyphenolic compound, which is primarily derived from black tea through the oxidative fermentation of tea leaves. This compound is part of the theaflavins, which result from the enzymatic oxidation of catechins, the major constituents of green tea. It exhibits various biological activities due to its complex molecular structure, which includes multiple hydroxyl groups that facilitate specific intermolecular interactions.Formula:C43H32O20Purity:Min. 95%Color and Shape:Red PowderMolecular weight:868.7 g/molTheaflavin 3,3'-Digallate
CAS:Controlled ProductFormula:C43H32O20Color and Shape:NeatMolecular weight:868.70







