CAS 30465-68-0

5-methoxyquinolin-8-amine

Description:

5-Methoxyquinolin-8-amine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methoxy group (-OCH3) at the 5-position and an amino group (-NH2) at the 8-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, while the methoxy group can influence its reactivity and interaction with other molecules. 5-Methoxyquinolin-8-amine may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it of interest in synthetic organic chemistry. Additionally, compounds of this class can exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. Its specific applications and behavior in biological systems would depend on further studies and context within medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c1-13-9-5-4-8(11)10-7(9)3-2-6-12-10/h2-6H,11H2,1H3

SMILES: COc1ccc(c2c1cccn2)N

Synonyms:

• 5-Methoxy-quinolin-8-ylamine
• 8-Quinolinamine, 5-Methoxy-

8-Quinolinamine, 5-methoxy-

CAS: 30465-68-0

Formula: C₁₀H₁₀N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.1992

Ref: IN-DA00306I

5-Methoxyquinolin-8-amine

CAS: 30465-68-0

5-Methoxyquinolin-8-amine

Purity: 97%

Molecular weight: 174.20g/mol

Ref: 54-OR76684

5-Methoxyquinolin-8-amine

CAS: 30465-68-0

Formula: C₁₀H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.203

Ref: 10-F464986

8-Amino-5-methoxyquinoline

CAS: 30465-68-0

8-Amino-5-methoxyquinoline is a quinoline derivative that can be prepared by a radical mechanism. It is synthesized from ammonium nitrate and c–h bond. 8-Amino-5-methoxyquinoline has been used in the synthesis of various other compounds and for the study of its functional groups. The compound also has been studied to determine if it can be an effective catalyst for reactions such as amination reactions, but it is not considered very efficient in this role.

Formula: C₁₀H₁₀N₂O

Purity: Min. 95%

Molecular weight: 174.2 g/mol

Ref: 3D-FBA46568