CAS 304655-78-5
:3-amino-1,2,4-triazole-5-carboxylic acid hydrate,
Description:
3-Amino-1,2,4-triazole-5-carboxylic acid hydrate is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a carboxylic acid functional group, contributing to its potential as a versatile building block in organic synthesis and pharmaceutical applications. The hydrate form indicates the presence of water molecules associated with the compound, which can influence its solubility and stability. Typically, compounds like this exhibit moderate to high solubility in polar solvents due to the presence of polar functional groups. The compound may also display biological activity, making it of interest in agricultural and medicinal chemistry. Its CAS number, 304655-78-5, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, 3-amino-1,2,4-triazole-5-carboxylic acid hydrate is a significant compound in various chemical research fields.
Formula:C3H6N4O3
InChI:InChI=1/C3H4N4O2.H2O/c4-3-5-1(2(8)9)6-7-3;/h(H,8,9)(H3,4,5,6,7);1H2
SMILES:c1(C(=O)O)[nH]c(=N)[nH]n1.O
Synonyms:- 3-amino-1H-1,2,4-triazole-5-carboxylic acid hydrate
- 3-Amino-1,2,4-Triazole-5-Carboxylic Acid Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-1,2,4-Triazole-3-carboxylic acid, 5-amino-, hydrate (1:1)
CAS:Formula:C3H6N4O3Purity:98%Color and Shape:SolidMolecular weight:146.10473-Amino-1H-1,2,4-triazole-5-carboxylic acid hydrate
CAS:3-Amino-1H-1,2,4-triazole-5-carboxylic acid hydrate
Purity:99%Molecular weight:146.10g/mol3-Amino-1,2,4-triazole-5-carboxylic acid hydrate
CAS:3-Amino-1,2,4-triazole-5-carboxylic acid hydrate is an inhibitor that inhibits corrosion in metal. It has been shown to be a very effective inhibitor of corrosion in metal at relatively low concentrations. Inhibition efficiency increases with the concentration of 3-amino-1,2,4-triazole-5 carboxylic acid hydrate. This compound also has a copolymerization effect on some polymers and can be used as a corrosion inhibitor for these types of materials.Formula:C3H4N4O2·xH2OColor and Shape:White PowderMolecular weight:128.09 g/mol3-amino-1H-1,2,4-triazole-5-carboxylic acid
CAS:Formula:C3H4N4O2Purity:97%Color and Shape:SolidMolecular weight:128.091



