CAS 304655-82-1

2,7-Naphthalenedisulfonic acid, 4-hydroxy-5-[[(2-hydroxyphenyl)methylene]amino]-, sodium salt, hydrate (1:1:1)

Description:

2,7-Naphthalenedisulfonic acid, 4-hydroxy-5-[[(2-hydroxyphenyl)methylene]amino]-, sodium salt, hydrate (1:1:1), with CAS number 304655-82-1, is a complex organic compound characterized by its sulfonic acid groups and a hydroxyl group, which contribute to its solubility in water and potential applications in various chemical processes. This compound features a naphthalene backbone, which is a polycyclic aromatic hydrocarbon, providing stability and hydrophobic characteristics. The presence of the sulfonic acid groups enhances its ionic nature, making it useful as a dye or pigment in various industries, including textiles and plastics. The hydroxyl and amine functionalities suggest potential reactivity, allowing for further chemical modifications or interactions with other substances. As a sodium salt, it is likely to exhibit good solubility in aqueous solutions, facilitating its use in formulations. Additionally, the hydrate form indicates that it can incorporate water molecules into its structure, which may influence its physical properties, such as melting point and stability. Overall, this compound's unique structure and functional groups make it a versatile candidate for various applications in chemistry and materials science.

Formula: C₁₇H₁₃NO₈S₂·H₂O·Na

InChI: InChI=1S/C17H13NO8S2.Na.H2O/c19-15-4-2-1-3-10(15)9-18-14-7-12(27(21,22)23)5-11-6-13(28(24,25)26)8-16(20)17(11)14;;/h1-9,19-20H,(H,21,22,23)(H,24,25,26);;1H2

InChI key: InChIKey=UWMOGEIXYQESAB-UHFFFAOYSA-N

SMILES: N(=CC1=C(O)C=CC=C1)C=2C3=C(C=C(S(=O)(=O)O)C=C3O)C=C(S(=O)(=O)O)C2.[Na].O

Synonyms:

• 2,7-Naphthalenedisulfonic acid, 4-hydroxy-5-[[(2-hydroxyphenyl)methylene]amino]-, sodium salt, hydrate (1:1:1)
• 2,7-Naphthalenedisulfonic acid, 4-hydroxy-5-[[(2-hydroxyphenyl)methylene]amino]-, monosodium salt, monohydrate

Azomethine-H monosodium salt monohydrate

CAS: 304655-82-1

Azomethine-H is a research chemical that is used as a versatile building block for the synthesis of other compounds. It has been shown to be an intermediate in the synthesis of many complex compounds, and can also be used as a reagent or speciality chemical. Azomethine-H is soluble in water and organic solvents, which makes it useful for reactions involving deprotection, extraction, or alkylation. The CAS registry number for this compound is 304655-82-1.

Formula: C₁₇H₁₂NNaO₈S₂·H₂O

Purity: Min. 95.0 Area-%

Color and Shape: Yellow Powder

Molecular weight: 463.42 g/mol

Ref: 3D-FA11956