CAS 304655-86-5
:martius yellow, sodium salt monohydrate
Description:
Martius Yellow, sodium salt monohydrate, is a synthetic organic compound primarily used as a dye and indicator in various applications. It is characterized by its bright yellow color, which is attributed to its azo dye structure. The compound is soluble in water, making it suitable for use in aqueous solutions. Its chemical structure includes a sodium salt form, which enhances its solubility and stability in different environments. Martius Yellow exhibits good lightfastness and is often employed in biological staining, particularly in histology and microscopy, due to its ability to selectively bind to certain cellular components. Additionally, it may have applications in the textile industry and as a pH indicator. Safety data indicates that, while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure. As with many synthetic dyes, environmental considerations regarding its disposal and potential ecological impact are important.
Formula:C10H7N2NaO6
InChI:InChI=1/C10H6N2O5.Na.H2O/c13-10-7-4-2-1-3-6(7)8(11(14)15)5-9(10)12(16)17;;/h1-5,13H;;1H2/q;+1;/p-1
Synonyms:- Sodium 2,4-Dinitronaphthalen-1-Olate Hydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Naphthalenol, 2,4-dinitro-, sodium salt, hydrate (1:1:1)
CAS:Formula:C10H8N2NaO6Molecular weight:275.1701

