CAS 304675-72-7
:4-nitroguaiacol, potassium salt hydrate
Description:
4-Nitroguaiacol, potassium salt hydrate is a chemical compound characterized by its molecular structure, which includes a nitro group and a guaiacol moiety, with potassium serving as a counterion. This compound typically appears as a solid, often in crystalline form, and is soluble in water due to the presence of the potassium ion, which enhances its solubility. The nitro group contributes to its reactivity, making it useful in various chemical applications, including as an intermediate in organic synthesis and in the production of pharmaceuticals. The hydrate form indicates that the compound contains water molecules within its crystal structure, which can influence its stability and solubility. Additionally, 4-nitroguaiacol derivatives are known for their antioxidant properties and potential biological activities, making them of interest in medicinal chemistry. Safety data should be consulted for handling, as nitro compounds can pose health risks. Overall, this compound exemplifies the intersection of organic chemistry and practical applications in various fields.
Formula:C7H8KNO5
InChI:InChI=1/C7H7NO4.K.H2O/c1-12-7-4-5(8(10)11)2-3-6(7)9;;/h2-4,9H,1H3;;1H2/q;+1;/p-1
Synonyms:- Potassium 2-Methoxy-4-Nitrophenolate Hydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
