CAS 304687-29-4

5-Phenyl-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidin-2-amine

Description:

5-Phenyl-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidin-2-amine is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyrimidine moiety. This compound features a phenyl group and a trifluoromethyl group, which contribute to its unique chemical properties and potential biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The triazole and pyrimidine rings are known for their roles in various biological activities, including antimicrobial and anticancer properties. Additionally, the amine functional group can participate in hydrogen bonding, influencing the compound's solubility and reactivity. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Its specific interactions and efficacy would depend on further studies, including biological assays and structure-activity relationship evaluations.

Formula: C₁₂H₈F₃N₅

InChI: InChI=1S/C12H8F3N5/c13-12(14,15)9-6-8(7-4-2-1-3-5-7)17-11-18-10(16)19-20(9)11/h1-6H,(H2,16,19)

InChI key: InChIKey=LPYIIYWRMAUKKS-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(N=C(C1)C3=CC=CC=C3)=NC(N)=N2

Synonyms:

• 5-Phenyl-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
• [1,2,4]Triazolo[1,5-a]pyrimidin-2-amine, 5-phenyl-7-(trifluoromethyl)-
• 5-Phenyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2(1h)-imine
• 5-PHENYL-7-TRIFLUOROMETHYL-[1,2,4]TRIAZOLO[1,5-A]-PYRIMIDIN-2-YLAMINE

5-Phenyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine

CAS: 304687-29-4

Versatile small molecule scaffold

Formula: C₁₂H₈F₃N₅

Purity: Min. 95%

Molecular weight: 279.22 g/mol

Ref: 3D-EMA68729