CAS 3047-22-1
:1-but-3-en-1-yl-2,4-dichlorobenzene
Description:
1-But-3-en-1-yl-2,4-dichlorobenzene, with the CAS number 3047-22-1, is an organic compound characterized by its unique structure that combines a butenyl group with a dichlorobenzene moiety. This compound features a vinyl group (the butenyl part) that introduces unsaturation, making it reactive in various chemical processes. The presence of two chlorine atoms on the benzene ring at the 2 and 4 positions contributes to its electrophilic character and can influence its reactivity and stability. Typically, compounds like this may exhibit properties such as moderate volatility and solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the aromatic ring. The dichlorobenzene component may also impart certain toxicological properties, necessitating careful handling. Overall, 1-but-3-en-1-yl-2,4-dichlorobenzene is of interest in synthetic organic chemistry and may serve as an intermediate in the production of more complex chemical entities.
Formula:C10H10Cl2
InChI:InChI=1/C10H10Cl2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h2,5-7H,1,3-4H2
SMILES:C=CCCc1ccc(cc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
