CAS 3048-46-2
:4-methoxy-1,3-benzothiazole
Description:
4-Methoxy-1,3-benzothiazole is an organic compound characterized by its benzothiazole core, which consists of a benzene ring fused to a thiazole ring. The presence of a methoxy group (-OCH3) at the 4-position of the benzothiazole structure contributes to its chemical properties, including its solubility and reactivity. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and materials science. It may exhibit biological activity, making it of interest in medicinal chemistry for the development of new therapeutic agents. The compound's molecular structure allows for interactions with biological targets, and its derivatives can be synthesized to enhance specific properties. Additionally, 4-methoxy-1,3-benzothiazole can participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-donating nature of the methoxy group. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C8H7NOS
InChI:InChI=1/C8H7NOS/c1-10-6-3-2-4-7-8(6)9-5-11-7/h2-5H,1H3
SMILES:COc1cccc2c1ncs2
Synonyms:- Benzothiazole, 4-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methoxy-1,3-benzothiazole
CAS:Formula:C8H7NOSPurity:95%Color and Shape:SolidMolecular weight:165.21234-Methoxy-1,3-benzothiazole
CAS:4-Methoxy-1,3-benzothiazole is a chromophore that has been shown to inhibit the proliferation of cancer cells in vitro. It was also found to be a potential anticancer agent in vivo, but its mechanism of action has not yet been elucidated. 4-Methoxy-1,3-benzothiazole inhibits the production of pheomelanin and carotenoids by inhibiting tyrosine kinase activity. This leads to decreased production of melanin and carotenoids, which are responsible for the colouration of skin, hair and feathers. 4-Methoxy-1,3-benzothiazole is also mesomeric and can be used as an analog for other chromophores.Formula:C8H7NOSPurity:Min. 95%Molecular weight:165.21 g/mol



