CAS 30485-16-6

4-(9-hydroxy-3-{5'-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-2,3'-dimethyloctahydro-2,2'-bifuran-5-yl}-3,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl)-3-methoxy-2-methylpentanoic acid

Description:

The chemical substance known as "4-(9-hydroxy-3-{5'-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-2,3'-dimethyloctahydro-2,2'-bifuran-5-yl}-3,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl)-3-methoxy-2-methylpentanoic acid" with CAS number 30485-16-6 is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH), methoxy (-OCH3), and carboxylic acid (-COOH) groups. This compound features a spirocyclic framework, indicative of its unique stereochemistry and potential biological activity. The presence of multiple chiral centers suggests that it may exist in various stereoisomeric forms, which can influence its reactivity and interactions in biological systems. Its structural complexity may confer specific properties, such as solubility and stability, which are critical for its potential applications in pharmaceuticals or as a biochemical probe. Overall, the compound's detailed characterization would require advanced analytical techniques, including NMR spectroscopy, mass spectrometry, and X-ray crystallography, to elucidate its precise structure and confirm its identity.

Formula: C₃₅H₆₀O₁₁

InChI: InChI=1/C35H60O11/c1-18-12-20(3)35(40,16-36)46-27(18)25-13-19(2)30(43-25)33(8)11-10-26(44-33)32(7)15-34(42-17-32)14-24(37)21(4)29(45-34)22(5)28(41-9)23(6)31(38)39/h18-30,36-37,40H,10-17H2,1-9H3,(H,38,39)

InChI key: InChIKey=ZXLUKLZKZXJEFX-WALYMESLSA-N

SMILES: C[C@@]1(O[C@]2(O[C@]([C@H]([C@H]([C@@H](C(O)=O)C)OC)C)([C@H](C)[C@@H](O)C2)[H])CC1)[C@@]3(O[C@@](C)(CC3)[C@@]4(O[C@](C[C@@H]4C)([C@]5(O[C@](CO)(O)[C@H](C)C[C@@H]5C)[H])[H])[H])[H]

Synonyms:

• 1,6-Dioxaspiro[4.5]decane, monensin deriv.
• 1,6-Dioxaspiro[4.5]decane-7-butyric acid, 9-hydroxy-β-methoxy-α,γ,2,8-tetramethyl-2-[tetrahydro-5-methyl-5-[tetrahydro-3-methyl-5-[tetrahydro-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyl-2H-pyran-2-yl]-2-furyl]-2-furyl]-
• 16-Deethyl-16-methylmonensin
• Monensin, 16-deethyl-16-methyl-
• Monensin B

Monensin B

CAS: 30485-16-6

Monensin B, a polyketide from Streptomyces cinnamonensis, arises with Monensin A in fermentation, varying by ethyl/methylmalonyl-CoA levels.

Formula: C₃₅H₆₀O₁₁

Color and Shape: Solid

Molecular weight: 656.854

Ref: TM-T40383

Monensin B

CAS: 30485-16-6

Formula: C₃₅H₆₀O₁₁

Purity: 95%~99%

Color and Shape: White Powder

Molecular weight: 656.854

Ref: BP-BP2019

Monensin B

CAS: 30485-16-6

Monensin B is a polyether ionophore antibiotic, which is a secondary metabolite produced by the bacterium *Streptomyces cinnamonensis*. The mode of action involves the disruption of ion concentration gradients across cellular membranes by facilitating the transport of mono- and divalent cations, particularly sodium and potassium ions, across lipid bilayers. This ion transport disrupts cellular ionic balances, which is detrimental to certain microorganisms and some coccidian protozoa.

Formula: C₃₅H₆₀O₁₁

Purity: Min. 95%

Molecular weight: 656.8 g/mol

Ref: 3D-FBA48516

monensin B

CAS: 30485-16-6

Formula: C₃₅H₆₀O₁₁

Purity: 97%

Molecular weight: 656.8443

Ref: IN-DA00BWNZ