CAS 30486-73-8

2-Amino-5-fluorobenzimidazole

Description:

2-Amino-5-fluorobenzimidazole is a chemical compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. The presence of an amino group (-NH2) at the 2-position and a fluorine atom at the 5-position of the benzimidazole structure contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. It is often studied for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active molecules. The fluorine atom can enhance the compound's lipophilicity and metabolic stability, making it a valuable component in drug design. Additionally, 2-amino-5-fluorobenzimidazole may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine substituent, which can influence its reactivity and interaction with biological targets. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards.

Formula: C₇H₆FN₃

InChI: InChI=1/C7H6FN3/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H3,9,10,11)

SMILES: c1cc2c(cc1F)[nH]c(=N)[nH]2

Synonyms:

• 1H-benzimidazol-2-amine, 5-fluoro-
• 5-Fluoro-1H-benzimidazol-2-amine

1H-Benzimidazol-2-amine, 6-fluoro-

CAS: 30486-73-8

Formula: C₇H₆FN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 151.1410

Ref: IN-DA0030B3

2-Amino-5-fluorobenzimidazole

CAS: 30486-73-8

2-Amino-5-fluorobenzimidazole

Purity: 97%

Molecular weight: 151.14g/mol

Ref: 54-PC109081

5-Fluoro-1H-benzimidazole-2-amine

CAS: 30486-73-8

Formula: C₇H₆FN₃

Purity: 98%

Molecular weight: 151.144

Ref: 10-F220014