CAS 304876-31-1

5-bromospiro[indoline-3,4'-tetrahydropyran]-2-one

Description:

5-Bromospiro[indoline-3,4'-tetrahydropyran]-2-one is a chemical compound characterized by its unique spirocyclic structure, which features a bromine atom and a tetrahydropyran moiety. This compound belongs to a class of molecules known for their potential biological activities, including antimicrobial and anticancer properties. The presence of the indoline and tetrahydropyran rings contributes to its structural complexity and may influence its reactivity and interaction with biological targets. Typically, compounds like this exhibit moderate to high lipophilicity due to their cyclic structures, which can affect their solubility and permeability in biological systems. The bromine substituent can also enhance the compound's reactivity, making it a useful intermediate in organic synthesis. Additionally, the compound's unique structure may allow for various functionalizations, making it of interest in medicinal chemistry and drug development. Overall, 5-bromospiro[indoline-3,4'-tetrahydropyran]-2-one represents a fascinating area of study due to its potential applications in pharmaceuticals and materials science.

Formula: C₁₂H₁₂BrNO₂

InChI: InChI=1/C12H12BrNO2/c13-8-1-2-10-9(7-8)12(11(15)14-10)3-5-16-6-4-12/h1-2,7H,3-6H2,(H,14,15)

SMILES: c1cc2c(cc1Br)C1(CCOCC1)C(=N2)O

5-bromo-1,2-dihydrospiro[indole-3,4'-oxane]-2-one

CAS: 304876-31-1

Formula: C₁₂H₁₂BrNO₂

Molecular weight: 282.1332

Ref: IN-DA0030BK

5-Bromo-2',3',5',6'-tetrahydrospiro[3H-indole-3,4'-[4H]pyran]-2(1H)-one

CAS: 304876-31-1

Purity: 95.0%

Molecular weight: 282.1369934082031

Ref: 10-F433788

5-bromo-1,2-dihydrospiro[indole-3,4'-oxane]-2-one

CAS: 304876-31-1

Versatile small molecule scaffold

Formula: C₁₂H₁₂BrNO₂

Purity: Min. 95%

Molecular weight: 282.14 g/mol

Ref: 3D-EMA87631