CAS 30489-27-1
:Alisol C
Description:
Alisol C, with the CAS number 30489-27-1, is a naturally occurring triterpenoid compound primarily derived from the rhizomes of the plant Alisma orientale, commonly known as water plantain. This compound is characterized by its complex tetracyclic structure, which is typical of many triterpenoids. Alisol C exhibits various biological activities, including anti-inflammatory, hepatoprotective, and potential antitumor effects, making it of interest in pharmacological research. It is often studied for its role in traditional medicine and its potential therapeutic applications. In terms of solubility, Alisol C is generally more soluble in organic solvents than in water, which is common for many triterpenoids. Its chemical properties, including melting point and specific reactivity, can vary based on the purity and specific conditions under which it is analyzed. Overall, Alisol C represents a significant compound in the field of natural products chemistry, with ongoing research into its health benefits and mechanisms of action.
Formula:C30H46O5
InChI:InChI=1S/C30H46O5/c1-16(13-19(32)25-27(4,5)35-25)23-17-14-18(31)24-28(6)11-10-22(34)26(2,3)21(28)9-12-29(24,7)30(17,8)15-20(23)33/h16,18-19,21,24-25,31-32H,9-15H2,1-8H3/t16-,18+,19+,21+,24+,25-,28+,29+,30+/m1/s1
InChI key:InChIKey=DORJGGFFCMZTHW-KXVAGGRESA-N
SMILES:C[C@@]12[C@]3(C)C(=C([C@@H](C[C@H](O)[C@@]4([C@](C)(C)O4)[H])C)C(=O)C3)C[C@H](O)[C@]1([C@]5(C)[C@@](CC2)(C(C)(C)C(=O)CC5)[H])[H]
Synonyms:- (8α,9β,11β,14β,23S,24R)-24,25-Epoxy-11,23-dihydroxydammar-13(17)-ene-3,16-dione
- 16-Oxoalisol B
- 8a,9b,14b-Dammar-13(17)-ene-3,16-dione, 24,25-epoxy-11b,23-dihydroxy- (8CI)
- 8α,9β,14β-Dammar-13(17)-ene-3,16-dione, 24,25-epoxy-11β,23-dihydroxy-
- Alisol C
- Dammar-13(17)-ene-3,16-dione, 24,25-epoxy-11,23-dihydroxy-, (8α,9β,11β,14β,23S,24R)-
- (8α,9β,14β,23S,24R)-11β,23-Dihydroxy-24,25-epoxy-5α-dammar-13(17)-ene-3,16-dione
- (8alpha,9beta,11beta,14beta,23S,24R)-24,25-Epoxy-11,23-dihydroxydammar-13(17)-ene-3,16-dione
- (5R,8S,9S,10S,11S,14R)-17-[(2R,4S)-4-[(2R)-3,3-dimethyloxiran-2-yl]-4-hydroxybutan-2-yl]-11-hydroxy-4,4,8,10,14-pentamethyl-2,5,6,7,9,11,12,15-octahydro-1H-cyclopenta[a]phenanthrene-3,16-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Alisol C
CAS:Alisol C enhances glucose uptake in Hep G2 cells and may treat hypoglycemia in A. orientalis, but can cause nephrotoxicity with Zexie components.Formula:C30H46O5Purity:98%Color and Shape:SolidMolecular weight:486.693Alisol C
CAS:Controlled ProductAlisol C is a triterpenoid, which is derived from the rhizomes of the Alisma plant, specifically Alisma orientale. It is a natural product that exhibits several pharmacological activities by modulating various biological pathways within the body. Alisol C intervenes in cellular processes by influencing signaling pathways and molecular targets, including those involved in lipid metabolism and inflammation.Formula:C30H46O5Purity:Min. 95%Molecular weight:486.7 g/mol


