CAS 30489-43-1

imidazo[1,2-a]pyridin-3-ylmethanol

Description:

Imidazo[1,2-a]pyridin-3-ylmethanol is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a hydroxymethyl group (-CH2OH) attached to the pyridine ring, enhancing its reactivity and potential for forming hydrogen bonds. The presence of both nitrogen atoms in the imidazole and pyridine rings imparts basicity and can influence its interaction with biological targets, making it of interest in medicinal chemistry. Imidazo[1,2-a]pyridin-3-ylmethanol is often studied for its potential pharmacological applications, including antimicrobial and anticancer activities. Its solubility and stability can vary depending on the solvent and pH, which are important factors to consider in synthesis and application. Additionally, the compound's structure allows for various functionalizations, making it a versatile building block in organic synthesis. Overall, imidazo[1,2-a]pyridin-3-ylmethanol is a compound of significant interest due to its structural features and potential biological activities.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c11-6-7-5-9-8-3-1-2-4-10(7)8/h1-5,11H,6H2

SMILES: c1ccn2c(cnc2c1)CO

Synonyms:

• Imidazo[1,2-a]pyridine-3-methanol

Imidazo[1,2-a]pyridine-3-methanol

CAS: 30489-43-1

Formula: C₈H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA0030CG

Imidazo[1,2-a]pyridin-3-ylmethanol

CAS: 30489-43-1

Imidazo[1,2-a]pyridin-3-ylmethanol

Purity: 95%

Molecular weight: 148.16g/mol

Ref: 54-OR921772

Imidazo[1,2-a]pyridin-3-ylmethanol

CAS: 30489-43-1

Formula: C₈H₈N₂O

Purity: 95%

Color and Shape: White powder

Molecular weight: 148.165

Ref: 10-F221932

Imidazo[1,2-a]pyridin-3-ylmethanol

CAS: 30489-43-1

Imidazo[1,2-a]pyridin-3-ylmethanol (IM) is a heterocyclic compound that has been used as a fluorescent sensor for acidic environments. IM has been shown to emit fluorescence when it reacts with hydroxymethyl groups in the presence of solvents. This reaction is an example of fluorescence emission. The emission of the molecule is dependent on its environment, and can be sensitive to changes in pH or solvent composition. IM has also been used extensively in synthetic organic chemistry as a reactive intermediate, due to its high reactivity and low toxicity.

Formula: C₈H₈N₂O

Purity: Min. 95%

Molecular weight: 148.17 g/mol

Ref: 3D-FBA48943