CAS 304901-48-2
:Benzenethiol, 2-fluoro-5-(trifluoromethyl)-
Description:
Benzenethiol, 2-fluoro-5-(trifluoromethyl)-, also known by its CAS number 304901-48-2, is an organofluorine compound characterized by the presence of a thiol (-SH) group attached to a benzene ring that is further substituted with a fluorine atom at the 2-position and a trifluoromethyl group (-CF3) at the 5-position. This compound exhibits properties typical of both thiols and fluorinated aromatic compounds, including potential reactivity due to the thiol group, which can participate in nucleophilic reactions. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity and stability. Additionally, the fluorine substituents can affect the electronic properties of the aromatic ring, potentially altering its reactivity and interaction with other chemical species. Benzenethiol derivatives are often studied for their applications in materials science, pharmaceuticals, and as intermediates in organic synthesis. Safety considerations should be taken into account due to the potential toxicity associated with thiol compounds and the environmental impact of fluorinated substances.
Formula:C7H4F4S
InChI:InChI=1S/C7H4F4S/c8-5-2-1-4(3-6(5)12)7(9,10)11/h1-3,12H
InChI key:InChIKey=KWAZFGPHDLINBM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(S)=C(F)C=C1
Synonyms:- Benzenethiol, 2-fluoro-5-(trifluoromethyl)-
- 2-Fluoro-5-(trifluoromethyl)benzene-1-thiol
- 2-Fluoro-5-trifluoromethylbenzenethiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Fluoro-5-trifluoromethylbenzenethiol
CAS:Formula:C7H4F4SColor and Shape:Liquid, ClearMolecular weight:196.16
