CAS 304902-96-3

5-Bromo-2-cyclopropylpyrimidine

Description:

5-Bromo-2-cyclopropylpyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position and a cyclopropyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the cyclopropyl group. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs. The bromine substituent can enhance reactivity, allowing for further chemical modifications. Additionally, the cyclopropyl group can influence the compound's conformation and steric properties, potentially affecting its interactions with biological targets. Overall, 5-Bromo-2-cyclopropylpyrimidine is a valuable compound in synthetic organic chemistry and medicinal chemistry, with applications that may extend to various fields, including agrochemicals and materials science.

Formula: C₇H₇BrN₂

InChI: InChI=1S/C7H7BrN2/c8-6-3-9-7(10-4-6)5-1-2-5/h3-5H,1-2H2

SMILES: C1CC1c1ncc(cn1)Br

Synonyms:

• 2-Cyclopropyl-5-bromopyrimidine

Pyrimidine, 5-bromo-2-cyclopropyl-

CAS: 304902-96-3

Formula: C₇H₇BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.0479

Ref: IN-DA0030C0

5-bromo-2-cyclopropylpyrimidine

CAS: 304902-96-3

5-bromo-2-cyclopropylpyrimidine

Purity: 95%

Molecular weight: 199.05g/mol

Ref: 54-OR959384

5-Bromo-2-cyclopropylpyrimidine

CAS: 304902-96-3

Formula: C₇H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.051

Ref: 10-F221968

5-Bromo-2-cyclopropylpyrimidine

CAS: 304902-96-3

5-Bromo-2-cyclopropylpyrimidine is a chiral molecule that has two enantiomers. It can exist as a racemic mixture (a 50/50 mixture of the two enantiomers), or as an enantioenriched sample (containing one of the two enantiomers in large excess). The former is a mixture, whereas the latter is a single pure enantiomer. 5-Bromo-2-cyclopropylpyrimidine can be separated into its two components by using chiral columns and then analyzed by NMR spectroscopy. The individual peaks in the spectrum correspond to either one or the other of the two possible configurations.

Formula: C₇H₇BrN₂

Purity: Min. 95%

Molecular weight: 199.05 g/mol

Ref: 3D-EMA90296