CAS 30505-63-6

BPP 5a

Description:

BPP 5a, with the CAS number 30505-63-6, is a chemical compound that belongs to the class of phosphonates. It is characterized by its unique molecular structure, which typically includes phosphorus, oxygen, and carbon atoms. This compound is often studied for its potential applications in various fields, including agriculture, where it may serve as a plant growth regulator or a pesticide. BPP 5a may exhibit properties such as stability under certain environmental conditions, solubility in organic solvents, and specific reactivity with biological systems. Its safety profile, including toxicity and environmental impact, is crucial for its application, necessitating thorough evaluation in accordance with regulatory standards. As with many chemical substances, understanding its behavior in different conditions, such as pH and temperature, is essential for predicting its efficacy and safety in practical applications. Further research may be required to fully elucidate its characteristics and potential uses in various industries.

Formula: C₃₀H₄₁N₇O₇

InChI: InChI=1/C30H41N7O7/c1-17(29(42)37-14-6-10-24(37)30(43)44)33-28(41)23(15-18-16-32-20-8-3-2-7-19(18)20)36-26(39)21(9-4-5-13-31)35-27(40)22-11-12-25(38)34-22/h2-3,7-8,16-17,21-24,32H,4-6,9-15,31H2,1H3,(H,33,41)(H,34,38)(H,35,40)(H,36,39)(H,43,44)/t17-,21-,22-,23-,24-/m0/s1

SMILES: C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N=C([C@H](Cc1c[nH]c2ccccc12)N=C([C@H](CCCCN)N=C([C@@H]1CCC(=N1)O)O)O)O

Synonyms:

• Pyr-Lys-Trp-Ala-Pro-OH
• 5-oxo-L-prolyl-L-lysyl-L-tryptophyl-L-alanyl-L-proline

Bradykinin potentiator-5

CAS: 30505-63-6

Bradykinin potentiator-5 is a peptide inflammatory mediator, causes blood vessels to dilate (enlarge), and therefore causes blood pressure to fall.

Formula: C₃₀H₄₁N₇O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 611.69

Ref: TM-T25173

BPP 5a Pyr-Lys-Trp-Ala-Pro-OH

CAS: 30505-63-6

BPP 5a is an amide-based enzyme inhibitor with potent activity against bradykinin b2 receptor. It binds to the b2 receptor and inhibits its enzymatic activity, leading to a decrease in blood pressure. BPP 5a is orally administered and has been shown to be safe and effective in clinical trials. It also has potentiation effects that are mediated by the inhibition of kininases, which leads to a decrease in circulating levels of bradykinin. BPP 5a is used as a diagnostic aid for porcine kidney disease and has been shown to inhibit the production of monoclonal antibodies.

Formula: C₃₀H₄₁N₇O₇

Purity: Min. 95%

Molecular weight: 611.69 g/mol

Ref: 3D-FB108631