CAS 30506-30-0
:1-Bromo-4-(ethylthio)benzene
Description:
1-Bromo-4-(ethylthio)benzene is an organic compound characterized by the presence of a bromine atom and an ethylthio group attached to a benzene ring. Its molecular structure consists of a benzene ring substituted at the para position with a bromine atom and an ethylthio group, which contributes to its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid with a distinct odor. It is moderately soluble in organic solvents but has limited solubility in water due to the hydrophobic nature of the benzene ring and the ethylthio group. The presence of the bromine atom makes it a potential electrophile, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the ethylthio group can influence the compound's reactivity and stability. 1-Bromo-4-(ethylthio)benzene is used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Proper handling and safety precautions are essential due to its potential toxicity and environmental impact.
Formula:C8H9BrS
InChI:InChI=1/C8H9BrS/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3
SMILES:CCSc1ccc(cc1)Br
Synonyms:- 4-Bromophenyl ethyl sulphide~4-(Ethylthio)bromobenzene
- 1-Bromo-4-(Ethylsulfanyl)Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-4-(ethylthio)benzene, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H9BrSPurity:97%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:217.12Benzene, 1-bromo-4-(ethylthio)-
CAS:Formula:C8H9BrSPurity:98%Color and Shape:LiquidMolecular weight:217.1261
