CAS 3051-89-6
:Methyl 2,3-di-O-methyl-4,6-O-(phenylmethylene)-α-D-glucopyranoside
Description:
Methyl 2,3-di-O-methyl-4,6-O-(phenylmethylene)-α-D-glucopyranoside, with CAS number 3051-89-6, is a glycoside derivative of glucose. This compound features a glucopyranoside structure, which is a six-membered cyclic form of glucose, modified by the presence of two methoxy groups at the 2 and 3 positions and a phenylmethylene group at the 4 and 6 positions. These modifications enhance its solubility and reactivity, making it useful in various chemical applications, including organic synthesis and as a potential intermediate in the production of more complex molecules. The presence of the phenylmethylene group contributes to its aromatic characteristics, which can influence its interactions in biological systems. This compound is typically studied in the context of carbohydrate chemistry and may exhibit interesting properties such as selective reactivity or binding affinity due to its structural features. As with many glycosides, it may also display specific biological activities, although detailed studies would be necessary to elucidate these aspects fully.
Formula:C16H22O6
InChI:InChI=1S/C16H22O6/c1-17-13-12-11(21-16(19-3)14(13)18-2)9-20-15(22-12)10-7-5-4-6-8-10/h4-8,11-16H,9H2,1-3H3/t11-,12-,13+,14-,15?,16+/m1/s1
InChI key:InChIKey=ZOYHXXDGSUTGIY-MHSGYVAISA-N
SMILES:O(C)[C@H]1[C@]2([C@](O[C@H](OC)[C@@H]1OC)(COC(O2)C3=CC=CC=C3)[H])[H]
Synonyms:- Glucopyranoside, methyl 4,6-O-benzylidene-2,3-di-O-methyl-, α-<span class="text-smallcaps">D</span>-
- Methyl 2,3-di-O-methyl-4,6-O-(phenylmethylene)-α-<span class="text-smallcaps">D</span>-glucopyranoside
- Methyl 4,6-O-benzylidene-2,3-di(O-methyl)-alpha-D-glucopyranoside
- NSC 185315
- Pyrano[3,2-d]-1,3-dioxin, α-<span class="text-smallcaps">D</span>-glucopyranoside deriv.
- methyl 4,6-O-benzylidene-2,3-di-O-methylhexopyranoside
- α-<span class="text-smallcaps">D</span>-Glucopyranoside, methyl 2,3-di-O-methyl-4,6-O-(phenylmethylene)-
- Pyrano[3,2-d]-1,3-dioxin, α-D-glucopyranoside deriv.
- α-D-Glucopyranoside, methyl 2,3-di-O-methyl-4,6-O-(phenylmethylene)-
- Methyl 2,3-di-O-methyl-4,6-O-(phenylmethylene)-α-D-glucopyranoside
- Glucopyranoside, methyl 4,6-O-benzylidene-2,3-di-O-methyl-, α-D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 4,6-o-benzylidene-2,3-di-o-methyl-α-d-glucopyranoside
CAS:Formula:C16H22O6Color and Shape:SolidMolecular weight:310.3423Methyl 4,6-O-benzylidene-2,3-di-O-methyl-a-D-glucopyranoside
CAS:Methyl 4,6-O-benzylidene-2,3-di-O-methyl-a-D-glucopyranoside is a high purity synthetic compound. It is an oligosaccharide that consists of a methylated glucose unit with four acetate groups and one benzyl group attached. Methyl 4,6-O-benzylidene-2,3-di-O-methyl-a-D-glucopyranoside is used as a substrate for glycosylation reactions and as a chromatographic marker.Formula:C16H22O6Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:310.35 g/mol


