CAS 30510-67-9

2-amino-N-cyclopropylbenzamide

Description:

2-amino-N-cyclopropylbenzamide is an organic compound characterized by its amine and amide functional groups. It features a cyclopropyl group attached to the nitrogen of the amide, which contributes to its unique chemical properties. The presence of the amino group (-NH2) enhances its potential for hydrogen bonding, influencing its solubility and reactivity. This compound typically exhibits moderate polarity due to the combination of hydrophobic cyclopropyl and hydrophilic amine and amide functionalities. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its CAS number, 30510-67-9, serves as a unique identifier for regulatory and safety information. Overall, 2-amino-N-cyclopropylbenzamide is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1/C10H12N2O/c11-9-4-2-1-3-8(9)10(13)12-7-5-6-7/h1-4,7H,5-6,11H2,(H,12,13)

SMILES: c1ccc(c(c1)C(=NC1CC1)O)N

Synonyms:

• Benzamide, 2-amino-N-cyclopropyl-
• 2-Amino-N-cyclopropylbenzamide

Benzamide, 2-amino-N-cyclopropyl-

CAS: 30510-67-9

Formula: C₁₀H₁₂N₂O

Purity: 95%

Molecular weight: 176.2151

Ref: IN-DA0030EZ

2-Amino-N-cyclopropylbenzamide

CAS: 30510-67-9

2-Amino-N-cyclopropylbenzamide

Purity: 95%

Molecular weight: 176.22g/mol

Ref: 54-OR94387

2-Amino-N-cyclopropylbenzamide

CAS: 30510-67-9

Formula: C₁₀H₁₂N₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 176.219

Ref: 10-F042411