CAS 3052-06-0
:1-(beta-D-arabinofuranosyl)-5-iodopyrimidine-2,4(1H,3H)-dione
Description:
1-(beta-D-arabinofuranosyl)-5-iodopyrimidine-2,4(1H,3H)-dione, with CAS number 3052-06-0, is a nucleoside analog characterized by its unique structure that incorporates a pyrimidine ring and an arabinofuranosyl sugar moiety. This compound features a 5-iodo substitution on the pyrimidine ring, which can influence its biological activity and interactions with nucleic acid targets. The presence of the dione functional groups contributes to its potential reactivity and stability. Typically, compounds of this nature are studied for their antiviral or anticancer properties, as they can interfere with nucleic acid synthesis or function. The specific stereochemistry of the arabinofuranosyl group is crucial for its biological activity, as it affects how the molecule interacts with enzymes and cellular components. Additionally, the iodine atom may enhance the compound's ability to participate in various chemical reactions or improve its pharmacological profile. Overall, this compound represents a significant interest in medicinal chemistry and drug development due to its structural features and potential therapeutic applications.
Formula:C9H11IN2O6
InChI:InChI=1/C9H11IN2O6/c10-3-1-12(9(17)11-7(3)16)8-6(15)5(14)4(2-13)18-8/h1,4-6,8,13-15H,2H2,(H,11,16,17)/t4-,5-,6+,8-/m1/s1
Synonyms:- Uracil, 1-.beta.-D-arabinofuranosyl-5-iodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-β-D-Arabinofuranosyl-5-iodouracil
CAS:Formula:C9H11IN2O6Purity:95%Color and Shape:SolidMolecular weight:370.09795-Iodoarabinouridine
CAS:5-Iodoarabinouridine is a Halo-nucleoside; Arabino-nucleoside.Formula:C9H11IN2O6Color and Shape:SolidMolecular weight:370.1Ref: TM-TNU0784
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire1-(b-D-Arabinofuranosyl)-5-iodouracil
CAS:1-(b-D-Arabinofuranosyl)-5-iodouracil is a synthetic nucleoside that has antiviral and anticancer properties. It is a monophosphate nucleotide that inhibits viral RNA synthesis by inhibiting the enzyme ribonucleotide reductase, which converts ribonucleotides to deoxyribonucleotides. This inhibitor also blocks DNA synthesis by preventing the incorporation of b-D-arabinofuranosyl monophosphate into DNA. 1-(b-D-Arabinofuranosyl)-5-iodouracil has been shown to be effective in treating various types of cancer, including breast, lung, and prostate cancers. It also exhibits antitumor activity against certain human leukemia cells.Formula:C9H11IN2O6Purity:Min. 95%Molecular weight:370.1 g/mol



