CAS 305331-46-8

1-[(2-hydroxyethyl)amino]-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile

Description:

1-[(2-hydroxyethyl)amino]-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile is a chemical compound characterized by its complex structure, which includes a pyrido-benzimidazole core, a hydroxyl group, and a carbonitrile functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in polar solvents due to the presence of the hydroxyl and amino groups. The carbonitrile group may contribute to its reactivity and ability to participate in various chemical reactions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The presence of the hydroxyl and amino groups may enhance its interaction with biological molecules, making it a candidate for further research in medicinal chemistry. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety and handling precautions should be observed due to potential toxicity or reactivity associated with its functional groups.

Formula: C₁₅H₁₄N₄O

InChI: InChI=1/C15H14N4O/c1-10-8-14(17-6-7-20)19-13-5-3-2-4-12(13)18-15(19)11(10)9-16/h2-5,8,17,20H,6-7H2,1H3

SMILES: Cc1cc(NCCO)n2c3ccccc3nc2c1C#N

Synonyms:

• Pyrido[1,2-a]benzimidazole-4-carbonitrile, 1-[(2-hydroxyethyl)amino]-3-methyl-
• 1-[(2-Hydroxyethyl)amino]-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile

Pyrido[1,2-a]benzimidazole-4-carbonitrile, 1-[(2-hydroxyethyl)amino]-3-methyl-

CAS: 305331-46-8

Formula: C₁₅H₁₄N₄O

Molecular weight: 266.2979

Ref: IN-DA0030G9

1-[(2-hydroxyethyl)amino]-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile

CAS: 305331-46-8

Purity: 95.0%

Molecular weight: 266.3039855957031

Ref: 10-F314459