CymitQuimica logo

CAS 30536-48-2

:

Caulilexin C

Description:
Caulilexin C, with the CAS number 30536-48-2, is a naturally occurring compound classified as a secondary metabolite. It is primarily derived from certain species of fungi, particularly those belonging to the genus Penicillium. This compound is known for its unique structural features, which include a complex ring system and various functional groups that contribute to its biological activity. Caulilexin C has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and cytotoxic effects. Its mechanism of action and specific interactions with biological targets are subjects of ongoing research. Additionally, the compound's solubility, stability, and reactivity can vary depending on environmental conditions, making it a topic of interest for further studies in natural product chemistry and drug development. Overall, Caulilexin C represents a fascinating example of the diverse chemical landscape found in nature and its potential applications in medicine and biotechnology.
Formula:C11H10N2O
InChI:InChI=1S/C11H10N2O/c1-14-13-8-9(6-7-12)10-4-2-3-5-11(10)13/h2-5,8H,6H2,1H3
InChI key:InChIKey=LIJIPBYXIXTNLE-UHFFFAOYSA-N
SMILES:C(C#N)C=1C=2C(N(OC)C1)=CC=CC2
Synonyms:
  • Caulilexine C
  • 1-Methoxy-1H-indole-3-acetonitrile
  • Indole-3-acetonitrile, 1-methoxy-
  • 1H-Indole-3-acetonitrile, 1-methoxy-
  • 1-Methoxyindoleacetonitrile
Found 5 products.