CymitQuimica logo

CAS 305381-67-3

:

1-methyl-1H-1,2,3-benzotriazole-5-carboxylic acid

Description:
1-Methyl-1H-1,2,3-benzotriazole-5-carboxylic acid is an organic compound characterized by its benzotriazole structure, which consists of a fused triazole and benzene ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in various applications. The presence of the methyl group at the 1-position of the triazole ring influences its chemical reactivity and stability. This compound is often studied for its potential applications in corrosion inhibition, as it can form stable complexes with metal ions, thereby protecting metal surfaces from oxidation. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 1-methyl-1H-1,2,3-benzotriazole-5-carboxylic acid is a versatile compound with significant industrial and research relevance.
Formula:C8H7N3O2
InChI:InChI=1/C8H7N3O2/c1-11-7-3-2-5(8(12)13)4-6(7)9-10-11/h2-4H,1H3,(H,12,13)
InChI key:SGHWYTLJLHVIBQ-UHFFFAOYSA-N
SMILES:Cn1c2ccc(cc2nn1)C(=O)O
Synonyms:
  • 1-methyl-1H-benzotriazole-5-carboxylic acid
Found 4 products.