CAS 30544-34-4
:2,3-Dibromofuran
Description:
2,3-Dibromofuran is a heterocyclic organic compound characterized by a furan ring with two bromine substituents at the 2 and 3 positions. Its molecular formula is C4H2Br2O, indicating the presence of four carbon atoms, two hydrogen atoms, two bromine atoms, and one oxygen atom. This compound typically appears as a colorless to light yellow liquid and is known for its distinctive aromatic properties. 2,3-Dibromofuran is soluble in organic solvents such as dichloromethane and ether, but it has limited solubility in water due to its nonpolar characteristics. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound exhibits potential biological activity, which has garnered interest in medicinal chemistry. However, handling 2,3-Dibromofuran requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures during its use and disposal.
Formula:C4H2Br2O
InChI:InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H
SMILES:c1coc(c1Br)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Dibromofuran, 97%, stab. with 0.5% calcium carbonate
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H2Br2OPurity:0.5%Color and Shape:Clear to turbid colorless to yellow or pale brown, LiquidMolecular weight:225.87



