CAS 30544-34-4: 2,3-Dibromofuran

Description:2,3-Dibromofuran is a heterocyclic organic compound characterized by a furan ring with two bromine substituents at the 2 and 3 positions. Its molecular formula is C4H2Br2O, indicating the presence of four carbon atoms, two hydrogen atoms, two bromine atoms, and one oxygen atom. This compound typically appears as a colorless to light yellow liquid and is known for its distinctive aromatic properties. 2,3-Dibromofuran is soluble in organic solvents such as dichloromethane and ether, but it has limited solubility in water due to its nonpolar characteristics. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound exhibits potential biological activity, which has garnered interest in medicinal chemistry. However, handling 2,3-Dibromofuran requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures during its use and disposal.

Formula:C₄H₂Br₂O

InChI:InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2,3-Dibromofuran, 97%, stab. with 0.5% calcium carbonate REF: 02-L15518CAS: 30544-34-4	0.5%	To inquire	Tue 08 Apr 25
Furan, 2,3-dibromo- REF: IN-DA0030IFCAS: 30544-34-4	97%	To inquire	Mon 14 Apr 25
2,3-Dibromofuran REF: 54-OR968339CAS: 30544-34-4	- - -	280.00 €	Mon 21 Apr 25
2,3-Dibromofuran REF: 10-F629459CAS: 30544-34-4	98%	To inquire	Thu 24 Apr 25
2,3-Dibromofuran REF: 3D-FBA54434CAS: 30544-34-4	Min. 95%	- - -	Discontinued product