CAS 30549-16-7
:2-Methoxy-5-nitrothiophene
Description:
2-Methoxy-5-nitrothiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a methoxy group (-OCH3) at the second position and a nitro group (-NO2) at the fifth position of the thiophene ring contributes to its unique chemical properties. This compound typically exhibits a yellow to orange color and is soluble in organic solvents. It is known for its potential applications in organic electronics, such as in the development of organic semiconductors and photovoltaic devices, due to its electronic properties. The nitro group can serve as a strong electron-withdrawing substituent, influencing the reactivity and stability of the compound. Additionally, the methoxy group can enhance solubility and modify the electronic distribution within the molecule. As with many nitro-containing compounds, 2-Methoxy-5-nitrothiophene should be handled with care due to potential toxicity and environmental concerns.
Formula:C5H5NO3S
InChI:InChI=1S/C5H5NO3S/c1-9-5-3-2-4(10-5)6(7)8/h2-3H,1H3
InChI key:InChIKey=DRJVACLGPCZGDX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1SC(OC)=CC1
Synonyms:- Thiophene, 2-methoxy-5-nitro-
- 2-Methoxy-5-nitrothiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
