
CAS 3056-97-1
:1-Amino-6,7-dimethyl-9,10-anthracenedione
Description:
1-Amino-6,7-dimethyl-9,10-anthracenedione, with the CAS number 3056-97-1, is an organic compound belonging to the anthraquinone family. It features a polycyclic aromatic structure characterized by two fused benzene rings and a quinone moiety, which contributes to its distinct chemical properties. The presence of amino and methyl substituents on the anthraquinone framework influences its reactivity and solubility. This compound is typically a solid at room temperature and exhibits a deep color, often associated with its conjugated system, which allows for strong light absorption. It is known for its potential applications in dyeing, as well as in the synthesis of various organic compounds. Additionally, the amino group can participate in further chemical reactions, making it a versatile intermediate in organic synthesis. Its properties, such as melting point, solubility, and spectral characteristics, can vary based on the specific conditions and solvents used. Overall, 1-amino-6,7-dimethyl-9,10-anthracenedione is a significant compound in both industrial and research contexts.
Formula:C16H13NO2
InChI:InChI=1S/C16H13NO2/c1-8-6-11-12(7-9(8)2)16(19)14-10(15(11)18)4-3-5-13(14)17/h3-7H,17H2,1-2H3
InChI key:InChIKey=OEKGYCGWQZJFDP-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(N)C=CC3)=CC(C)=C(C)C2
Synonyms:- Anthraquinone, 1-amino-6,7-dimethyl-
- 1-Amino-6,7-dimethyl-9,10-anthracenedione
- 1-Amino-6,7-dimethylanthraquinone
- 9,10-Anthracenedione, 1-amino-6,7-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
