CAS 30565-25-4

[carbamoyl(methyl)amino]acetate

Description:

Carbamoyl(methyl)amino)acetate, with the CAS number 30565-25-4, is an organic compound characterized by the presence of both carbamoyl and amino functional groups. This substance typically appears as a white to off-white solid and is soluble in polar solvents due to its ionic nature. The compound features a methyl group attached to the amino group, which can influence its reactivity and solubility. It is often used in biochemical applications, particularly in the synthesis of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as amide formation and nucleophilic substitutions. The presence of the acetate moiety suggests that it can act as a weak acid, contributing to its overall reactivity profile. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature, making it important to handle it under controlled conditions. Overall, carbamoyl(methyl)amino)acetate is a versatile compound with significant applications in organic synthesis and medicinal chemistry.

Formula: C₄H₇N₂O₃

InChI: InChI=1/C4H8N2O3/c1-6(4(5)9)2-3(7)8/h2H2,1H3,(H2,5,9)(H,7,8)/p-1

SMILES: CN(CC(=O)[O-])C(=N)O

Glycine, N-(aminocarbonyl)-N-methyl-

CAS: 30565-25-4

Formula: C₄H₈N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 132.1179

Ref: IN-DA0030KD

N-Carbamoyl-N-methylglycine

CAS: 30565-25-4

N-Carbamoyl-N-methylglycine

Purity: 97%

Ref: 54-OR1039338

Hydantoin Impurity 4 (3-Methylhydantoic Acid)

CAS: 30565-25-4

Formula: C₄H₈N₂O₃

Color and Shape: White To Off-White Solid

Molecular weight: 132.12

Ref: 4Z-H-020007

N-(aminocarbonyl)-N-methylglycine

CAS: 30565-25-4

Formula: C₄H₈N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 132.119

Ref: 10-F311152

N-(aminocarbonyl)-N-methylglycine

Controlled Product

CAS: 30565-25-4

Applications N-(aminocarbonyl)-N-methylglycine (cas# 30565-25-4) is a useful research chemical.

Formula: C₄H₈N₂O₃

Color and Shape: Neat

Molecular weight: 132.12

Ref: TR-A618163