CAS 3057-91-8

spiro[3.3]heptane-2,6-dicarboxylic acid

Description:

Spiro[3.3]heptane-2,6-dicarboxylic acid, with the CAS number 3057-91-8, is a bicyclic organic compound characterized by its unique spiro structure, which consists of a heptane framework with two carboxylic acid functional groups located at the 2 and 6 positions. This compound exhibits a rigid, three-dimensional conformation due to the spiro arrangement, which can influence its reactivity and interactions with other molecules. The presence of the carboxylic acid groups contributes to its acidity and potential for forming hydrogen bonds, making it soluble in polar solvents. Additionally, the compound may participate in various chemical reactions, such as esterification or amidation, due to the reactive nature of the carboxylic acid groups. Its structural features may also impart interesting properties, such as potential applications in materials science or organic synthesis. Overall, spiro[3.3]heptane-2,6-dicarboxylic acid is notable for its unique architecture and functional versatility in chemical reactions.

Formula: C₉H₁₂O₄

InChI: InChI=1/C9H12O4/c10-7(11)5-1-9(2-5)3-6(4-9)8(12)13/h5-6H,1-4H2,(H,10,11)(H,12,13)

SMILES: C1C(CC21CC(C2)C(=O)O)C(=O)O

Spiro[3.3]heptane-2,6-dicarboxylic acid

CAS: 3057-91-8

Formula: C₉H₁₂O₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 184.1892

Ref: IN-DA007K31

Spiro[3.3]heptane-2,6-dicarboxylic acid

CAS: 3057-91-8

Spiro[3.3]heptane-2,6-dicarboxylic acid

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 184.19g/mol

Ref: 54-OR317143

spiro-[3.3]-Heptane-2,6-dicarboxylic acid

CAS: 3057-91-8

Formula: C₉H₁₂O₄

Purity: 95.0%

Molecular weight: 184.191

Ref: 10-F045589

Spiro[3.3]heptane-2,6-dicarboxylic acid

CAS: 3057-91-8

Purity: 96%

Molecular weight: 184.1909943

Ref: 10-F602466

Spiro[3.3]heptane-2,6-dicarboxylic acid

CAS: 3057-91-8

Spiro[3.3]heptane-2,6-dicarboxylic acid is an isomeric form of glutamic acid that has a diastereomeric relationship with glutamic acid. It is used as a building block in organic synthesis, and it can be used to synthesize lactams, which are heterocyclic compounds that have the skeleton of a cyclic amide. Spiro[3.3]heptane-2,6-dicarboxylic acid also has an acidic nature and can be hydrolyzed under acidic conditions to produce hydrogen chloride gas. The molecule has been shown to undergo nucleophilic attack by chloride ions, forming a chloroformate ester intermediate. The stereochemistry of spiro[3.3]heptane-2,6-dicarboxylic acid is enantiopure because there are two chiral centers on the ring system.

Formula: C₉H₁₂O₄

Purity: Min. 95%

Molecular weight: 184.19 g/mol

Ref: 3D-DAA05791