CAS 305790-78-7

N-(5-Bromo-2-nitrophenyl)-N-methylglycine

Description:

N-(5-Bromo-2-nitrophenyl)-N-methylglycine, with the CAS number 305790-78-7, is a chemical compound characterized by its unique structure, which includes a brominated phenyl group and a nitro substituent. This compound is classified as an amino acid derivative due to the presence of the glycine moiety. The bromine and nitro groups contribute to its reactivity and potential applications in various chemical reactions, including those in medicinal chemistry and agrochemicals. The presence of the nitro group typically enhances the compound's electrophilicity, making it useful in nucleophilic substitution reactions. Additionally, the bromine atom can serve as a site for further functionalization. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions used. Overall, N-(5-Bromo-2-nitrophenyl)-N-methylglycine is of interest in research for its potential biological activities and as a building block in synthetic organic chemistry.

Formula: C₉H₉BrN₂O₄

InChI: InChI=1S/C9H9BrN2O4/c1-11(5-9(13)14)8-4-6(10)2-3-7(8)12(15)16/h2-4H,5H2,1H3,(H,13,14)

InChI key: InChIKey=AFORJLZSRAFPSP-UHFFFAOYSA-N

SMILES: N(CC(O)=O)(C)C1=C(N(=O)=O)C=CC(Br)=C1

Synonyms:

• N-(5-Bromo-2-nitrophenyl)-N-methylglycine
• 2-[(5-Bromo-2-nitrophenyl)(methyl)amino]acetic acid
• Glycine, N-(5-bromo-2-nitrophenyl)-N-methyl-

2-[(5-Bromo-2-nitrophenyl)(methyl)amino]acetic acid

CAS: 305790-78-7

Versatile small molecule scaffold

Formula: C₉H₉BrN₂O₄

Purity: Min. 95%

Molecular weight: 289.08 g/mol

Ref: 3D-FMA79078