CAS 3058-01-3
:(±)-3-Methyladipic acid
Description:
(±)-3-Methyladipic acid is a chiral dicarboxylic acid characterized by its two carboxyl functional groups (-COOH) and a methyl group attached to the third carbon of the adipic acid backbone. This compound has a molecular formula of C7H12O4 and a molecular weight that reflects its structure. It exists as a white crystalline solid at room temperature and is soluble in water, which is typical for dicarboxylic acids due to their ability to form hydrogen bonds. The presence of the methyl group introduces asymmetry, leading to two enantiomers, although the compound is often encountered as a racemic mixture. (±)-3-Methyladipic acid is of interest in various chemical syntheses and applications, including the production of polyesters and as a potential building block in organic synthesis. Its properties, such as melting point and boiling point, are influenced by the presence of the carboxylic acid groups, which can engage in intermolecular interactions. Overall, this compound plays a role in both industrial and academic research settings.
Formula:C7H12O4
InChI:InChI=1S/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)
InChI key:InChIKey=SYEOWUNSTUDKGM-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(CC(O)=O)C
Synonyms:- (3S)-3-methylhexanedioate
- 3-Methyl-1,6-Hexanedioic acid
- 3-Methylhexanedioic acid
- Adipic acid, β-methyl-
- Hexanedioic acid, 3-methyl-
- NSC 22069
- β-Methyladipic acid
- 3-Methyladipic acid
- 3-METHYLADIPIC ACID 99%
- 3-methylhexanedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Methyladipic Acid
CAS:Formula:C7H12O4Purity:>99.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:160.17Hexanedioic acid, 3-methyl-
CAS:Formula:C7H12O4Purity:99%Color and Shape:SolidMolecular weight:160.16783-Methyladipic acid
CAS:3-Methyladipic acid: a final metabolite in phytanic acid degradation, excreted in urine, especially in ARD patients who lack alternate pathways.Formula:C7H12O4Purity:99.87%Color and Shape:SolidMolecular weight:160.173-Methyladipic acid
CAS:3-Methyladipic acid is a molecule that is formed from the chemical reaction of ethylmalonic acid and pyrimidine compounds. 3-Methyladipic acid can be found in urine samples, where it is excreted as a hydrated form. It is also soluble in organic solvents such as ethanol and acetone. This compound has been used to identify the presence of fatty acids in biological fluids by liquid chromatography. The addition of malonic acid to 3-methyladipic acid changes its phase composition, which can be observed using a polarizing microscope. 3-Methyladipic acid has also been used to study tubule cells, which are found in the kidney and are involved in the reabsorption of water and electrolytes.Formula:C7H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:160.17 g/mol3-Methyladipic acid
CAS:Formula:C7H12O4Purity:98%Color and Shape:Solid, White powderMolecular weight:160.1693-(Methyl-d3)hexanedioic acid
CAS:Controlled ProductFormula:C7D3H9O4Color and Shape:NeatMolecular weight:163.186






