CAS 305808-19-9
:N-Benzoyl-2'-deoxy-adenosine
Description:
N-Benzoyl-2'-deoxy-adenosine is a modified nucleoside that features a benzoyl group attached to the nitrogen atom of the adenine base, specifically at the 2' position of the deoxyribose sugar. This compound is characterized by its structural components, which include a purine base (adenine), a deoxyribose sugar, and a benzoyl moiety that enhances its lipophilicity and potentially alters its biological activity. The presence of the benzoyl group can influence the compound's solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and biochemistry. N-Benzoyl-2'-deoxy-adenosine may exhibit properties such as antiviral or anticancer activity, depending on its mechanism of action and the specific biological pathways it interacts with. Its CAS number, 305808-19-9, allows for precise identification in chemical databases and literature. Overall, this compound serves as a valuable tool for research in nucleoside analogs and their applications in therapeutic development.
Formula:C17H17N5O4
InChI:InChI=1/C17H17N5O4/c23-7-12-11(24)6-13(26-12)22-9-20-14-15(18-8-19-16(14)22)21-17(25)10-4-2-1-3-5-10/h1-5,8-9,11-13,23-24H,6-7H2,(H,18,19,21,25)/t11-,12+,13+/m0/s1
Synonyms:- 4-(Benzoylamino)-1-(2-deoxy-beta-L-erythro-pentofuranosyl)-2(1H)-pyrimidinone
- N6-benzoyl-2'-deoxyadenosine hydrate
- N6-Benzoyl-2-deoxyadenosine (dA-Bz)
- N-benzoyl-2'-deoxyadenosine
- dA-Bz
- N6-Benzoyl-2'-deoxyadenosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N6-Benzoyl-2'-deoxyadenosine Hydrate
CAS:Formula:C17H17N5O4·xH2OPurity:>98.0%(HPLC)(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:355.35 (as Anhydrous)N6-Benzoyl-2'-deoxyadenosine monohydrate
CAS:N6-Benzoyl-2'-deoxyadenosine monohydratePurity:98%Molecular weight:373.36g/molN-(9-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-9H-purin-6-yl)benzamide
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:355.35400390625N-(9-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-9H-purin-6-yl)benzamide hydrate
CAS:Purity:98+%Molecular weight:373.3689880371094N6-Benzoyl-2'-deoxyadenosine monohydrate
CAS:N6-Benzoyl-2'-deoxyadenosine monohydrate is a nucleoside analogue that helps diagnose bacterial infections by binding to double-stranded DNA and altering its structure, which can subsequently be detected using electrophoresis.Formula:C17H19N5O5Color and Shape:SolidMolecular weight:373.363



