CAS 305808-19-9: N-Benzoyl-2'-deoxy-adenosine
Description:N-Benzoyl-2'-deoxy-adenosine is a modified nucleoside that features a benzoyl group attached to the nitrogen atom of the adenine base, specifically at the 2' position of the deoxyribose sugar. This compound is characterized by its structural components, which include a purine base (adenine), a deoxyribose sugar, and a benzoyl moiety that enhances its lipophilicity and potentially alters its biological activity. The presence of the benzoyl group can influence the compound's solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and biochemistry. N-Benzoyl-2'-deoxy-adenosine may exhibit properties such as antiviral or anticancer activity, depending on its mechanism of action and the specific biological pathways it interacts with. Its CAS number, 305808-19-9, allows for precise identification in chemical databases and literature. Overall, this compound serves as a valuable tool for research in nucleoside analogs and their applications in therapeutic development.
Formula:C17H17N5O4
InChI:InChI=1/C17H17N5O4/c23-7-12-11(24)6-13(26-12)22-9-20-14-15(18-8-19-16(14)22)21-17(25)10-4-2-1-3-5-10/h1-5,8-9,11-13,23-24H,6-7H2,(H,18,19,21,25)/t11-,12+,13+/m0/s1
- Synonyms:
- 4-(Benzoylamino)-1-(2-deoxy-beta-L-erythro-pentofuranosyl)-2(1H)-pyrimidinone
- N6-benzoyl-2'-deoxyadenosine hydrate
- N6-Benzoyl-2-deoxyadenosine (dA-Bz)
- N-benzoyl-2'-deoxyadenosine
- dA-Bz
- N6-Benzoyl-2'-deoxyadenosine

N6-Benzoyl-2'-deoxyadenosine Hydrate
Ref: 3B-B3101
1g | 324.00 € | ||
100mg | 58.00 € |

N-(9-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-9H-purin-6-yl)benzamide
Ref: 10-F213622
1g | 24.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
25g | To inquire | ||
100g | To inquire |

N-(9-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-9H-purin-6-yl)benzamide hydrate
Ref: 10-F634439
5g | To inquire | ||
10g | To inquire | ||
25g | To inquire |