CAS 305820-76-2
:6-(2,6-Dichlorophenyl)-2-[(4-fluorophenyl)amino]-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one
Description:
The chemical substance known as 6-(2,6-Dichlorophenyl)-2-[(4-fluorophenyl)amino]-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one, with the CAS number 305820-76-2, is a synthetic organic compound characterized by its complex heterocyclic structure. It features a pyrido[2,3-d]pyrimidinone core, which is a bicyclic system that incorporates nitrogen atoms, contributing to its potential biological activity. The presence of multiple halogen substituents, specifically dichlorophenyl and fluorophenyl groups, suggests that this compound may exhibit significant lipophilicity and possibly enhanced binding affinity to biological targets. Its structural features indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific pathways or diseases. The compound's unique arrangement of functional groups may also influence its solubility, stability, and reactivity, making it a subject of interest for further research in drug design and development. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the realm of organic chemistry.
Formula:C20H13Cl2FN4O
InChI:InChI=1S/C20H13Cl2FN4O/c1-27-18-11(9-14(19(27)28)17-15(21)3-2-4-16(17)22)10-24-20(26-18)25-13-7-5-12(23)6-8-13/h2-10H,1H3,(H,24,25,26)
InChI key:InChIKey=ZSHRAUSJZQDIJR-UHFFFAOYSA-N
SMILES:O=C1C(=CC=2C(N1C)=NC(NC3=CC=C(F)C=C3)=NC2)C4=C(Cl)C=CC=C4Cl
Synonyms:- PD 173956
- 6-(2,6-Dichlorophenyl)-2-[(4-fluorophenyl)amino]-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one
- Pyrido[2,3-d]pyrimidin-7(8H)-one, 6-(2,6-dichlorophenyl)-2-[(4-fluorophenyl)amino]-8-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
PD-173956
CAS:PD-173956 is an inhibitor of the Src family tyrosine kinases.Formula:C20H13Cl2FN4OColor and Shape:SolidMolecular weight:415.25
