CAS 305861-54-5
:2-(naphthalen-2-ylmethyl)-1,3-dioxolane
Description:
2-(Naphthalen-2-ylmethyl)-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a naphthyl group. The presence of the dioxolane moiety suggests that it may exhibit properties typical of cyclic ethers, such as being relatively stable and potentially reactive under certain conditions. The naphthyl group, derived from naphthalene, contributes to the compound's aromatic characteristics, which can influence its solubility, stability, and reactivity. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications as an intermediate or a building block in the synthesis of more complex molecules. Additionally, the presence of both aromatic and cyclic ether functionalities may impart unique electronic and steric properties, making it a candidate for further study in chemical reactivity and interactions. As with many organic compounds, its behavior in different solvents and under various conditions would be essential for understanding its practical applications.
Formula:C14H14O2
InChI:InChI=1/C14H14O2/c1-2-4-13-9-11(5-6-12(13)3-1)10-14-15-7-8-16-14/h1-6,9,14H,7-8,10H2
SMILES:c1ccc2cc(ccc2c1)CC1OCCO1
Synonyms:- 1,3-Dioxolane, 2-(2-Naphthalenylmethyl)-
- 2-(2-Naphthylmethyl)-1,3-dioxolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
