CAS 30588-33-1
:ethyl 3-oxo-2-phenyl-2,3-dihydro-1H-pyrazole-4-carboxylate
Description:
Ethyl 3-oxo-2-phenyl-2,3-dihydro-1H-pyrazole-4-carboxylate, identified by its CAS number 30588-33-1, is a chemical compound that belongs to the class of pyrazole derivatives. This substance typically exhibits a white to off-white crystalline appearance and is characterized by its unique pyrazole ring structure, which contributes to its reactivity and potential biological activity. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The compound may exhibit interesting pharmacological properties, including anti-inflammatory or analgesic effects, although specific biological activities can vary based on structural modifications and substituents. Its synthesis often involves multi-step reactions, and it may serve as an intermediate in the development of more complex molecules. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C12H12N2O3
InChI:InChI=1/C12H12N2O3/c1-2-17-12(16)10-8-13-14(11(10)15)9-6-4-3-5-7-9/h3-8,13H,2H2,1H3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl 5-Hydroxy-1-phenylpyrazole-4-carboxylate
CAS:Ethyl 5-Hydroxy-1-phenylpyrazole-4-carboxylatePurity:95%Molecular weight:232.24g/molethyl 3-oxo-2-phenyl-2,3-dihydro-1H-pyrazole-4-carboxylate
CAS:Ethyl 3-oxo-2-phenyl-2,3-dihydro-1H-pyrazole-4-carboxylate is an aliphatic amine that has been shown to be a piperidine and pyrrolidine analog. This compound has been shown to produce yields of up to 98% with the use of a simple procedure and it has been used as a starting material for the synthesis of other compounds. In addition, this compound behaves like an aliphatic amine because it can undergo reductive amination with nitrites and carboxamides.
Formula:C12H12N2O3Purity:Min. 95%Molecular weight:232.24 g/mol

