CAS 30595-81-4
:2-(2-Chloroethyl)-1,3-dimethylbenzene
Description:
2-(2-Chloroethyl)-1,3-dimethylbenzene, also known as o-Chloroethyl-1,3-dimethylbenzene, is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two methyl groups and a chloroethyl group. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is moderately soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the chloroethyl group introduces reactivity, making it a potential intermediate in organic synthesis and a subject of interest in medicinal chemistry. Its chemical properties include the ability to undergo electrophilic aromatic substitution reactions, and it may also participate in nucleophilic substitution reactions due to the presence of the chlorine atom. Safety considerations are important, as compounds containing chlorine can be hazardous, necessitating proper handling and storage protocols. Overall, 2-(2-Chloroethyl)-1,3-dimethylbenzene is a compound of interest in various chemical applications, particularly in the synthesis of more complex organic molecules.
Formula:C10H13Cl
InChI:InChI=1S/C10H13Cl/c1-8-4-3-5-9(2)10(8)6-7-11/h3-5H,6-7H2,1-2H3
InChI key:InChIKey=KVKNJNFMDWOQBE-UHFFFAOYSA-N
SMILES:C(CCl)C1=C(C)C=CC=C1C
Synonyms:- 2-(2-Chloroethyl)-1,3-dimethylbenzene
- m-Xylene, 2-(2-chloroethyl)-
- 2,6-Dimethylphenethyl chloride
- Benzene, 2-(2-chloroethyl)-1,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
