CAS 306-98-9
:Perfluoro-1,2-dimethylcyclohexane
Description:
Perfluoro-1,2-dimethylcyclohexane, with the CAS number 306-98-9, is a perfluorinated compound characterized by the complete fluorination of its carbon backbone, which enhances its chemical stability and hydrophobic properties. This substance is a cyclic compound featuring a cyclohexane ring with two methyl groups at the 1 and 2 positions. The presence of fluorine atoms significantly alters its physical and chemical properties, making it non-polar and highly resistant to chemical reactions, including oxidation and hydrolysis. As a result, it exhibits low surface tension and high thermal stability. Perfluoro-1,2-dimethylcyclohexane is typically used in specialized applications such as in the production of fluorinated polymers, as a solvent in chemical processes, and in various industrial applications where non-reactivity and thermal stability are crucial. However, due to environmental concerns associated with perfluorinated compounds, its use is subject to regulatory scrutiny, particularly regarding its persistence in the environment and potential bioaccumulation.
Formula:C8F16
InChI:InChI=1S/C8F16/c9-1(7(19,20)21)2(10,8(22,23)24)4(13,14)6(17,18)5(15,16)3(1,11)12
InChI key:InChIKey=GHBZJUJZNRLHBI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(F)C(C(F)(F)F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F
Synonyms:- 1,1,2,2,3,3,4,4,5,6-Decafluoro-5,6-Bis(Trifluoromethyl)Cyclohexane
- Cyclohexane, 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-bis(trifluoromethyl)-
- Cyclohexane, decafluoro-1,2-bis(trifluoromethyl)-
- Hexadecafluoro-(1,2-dimethylcyclohexane)
- Perfluoro(1,2-dimethylcyclohexane)
- Perfluoro-1,2-dimethylcyclohexane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclohexane, 1,1,2,2,3,3,4,4,5,6-decafluoro-5,6-bis(trifluoromethyl)-
CAS:Formula:C8F16Purity:70%Molecular weight:400.0601Perfluoro-1,2-dimethylcyclohexane
CAS:Formula:C8F16Purity:≥70%Color and Shape:LiquidMolecular weight:400.062Perfluoro(1,2-dimethylcyclohexane)
CAS:Perfluoro(1,2-dimethylcyclohexane)Purity:70%Color and Shape:LiquidMolecular weight:400.06g/molPerfluoro-1,2-Dimethylcyclohexane
CAS:Controlled ProductPerfluoro-1,2-dimethylcyclohexane is a solvent that has the ability to dissolve a wide range of substances. It is used in the manufacture of polymers and coatings, as well as in the production of other chemicals. Perfluoro-1,2-dimethylcyclohexane can be used for solvents such as chlorofluorocarbons (CFCs) and hydrochlorofluorocarbons (HCFCs), which are gases that deplete the stratospheric ozone layer. This solvent also has innovative properties, such as low volatility and high boiling point. The process to desorb this compound from soil is called geosorbent extraction. Perfluoro-1,2-dimethylcyclohexane can be extracted from water using an injected gas or liquid.Formula:C8F16Purity:Min. 95%Molecular weight:400.06 g/mol



