CAS 30608-02-7
:2,4-O-benzylidene-L-xylose
Description:
2,4-O-benzylidene-L-xylose is a chemical compound that belongs to the class of glycosides, specifically a derivative of the sugar L-xylose. It features a benzylidene group, which is a result of the condensation of benzaldehyde with the hydroxyl groups of L-xylose, leading to a stable acetal formation. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and methanol, but less soluble in water due to its hydrophobic benzylidene moiety. The presence of the benzylidene group enhances its stability and alters its reactivity compared to the parent sugar. 2,4-O-benzylidene-L-xylose is often used in organic synthesis and as an intermediate in the preparation of various chemical compounds. Its unique structure allows for potential applications in carbohydrate chemistry and the development of glycosylated compounds. As with many sugar derivatives, it may exhibit biological activity, although specific biological properties would require further investigation.
Formula:C12H14O5
InChI:InChI=1/C12H14O5/c13-6-9-11(15)10(7-14)17-12(16-9)8-4-2-1-3-5-8/h1-6,9-12,14-15H,7H2/t9-,10+,11+,12?/m1/s1
Synonyms:- 2,4-O-(Phenylmethylene)-L-xylose
- L-Xylose, 2,4-O-(phenylmethylene)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,4-O-Benzylidene-L-xylose
CAS:<p>2,4-O-Benzylidene-L-xylose is a white crystalline powder with a melting point of about 125°C. It is an acetate salt that can be used in the synthesis of many natural products. It has been shown to inhibit HMG-CoA reductase and is used in the treatment of hypercholesterolemia. The reaction mechanism for this compound is not well understood, but it is believed to involve an acid catalyst and an organic solvent. The yield for this compound is low and it requires a long reaction time due to its high reactivity.</p>Formula:C12H14O5Purity:Min. 95%Molecular weight:238.24 g/mol
