CAS 30609-79-1

4,4'-sulfonylbis(2,6-dichlorophenol)

Description:

4,4'-Sulfonylbis(2,6-dichlorophenol) is an organic compound characterized by its sulfonyl functional group linked to two 2,6-dichlorophenol moieties. This compound typically appears as a solid and is known for its stability under standard conditions. The presence of chlorine atoms in the phenolic rings enhances its chemical reactivity and contributes to its potential applications in various fields, including as a precursor in the synthesis of dyes, pharmaceuticals, and agrochemicals. The sulfonyl group imparts additional properties, such as increased solubility in polar solvents and the ability to participate in sulfonation reactions. Due to its structural features, this compound may exhibit biological activity, making it of interest in medicinal chemistry. However, handling precautions are necessary, as with many chlorinated compounds, due to potential toxicity and environmental concerns. Overall, 4,4'-sulfonylbis(2,6-dichlorophenol) is a significant compound in organic synthesis and materials science, warranting careful study and application.

Formula: C₁₂H₆Cl₄O₄S

InChI: InChI=1/C12H6Cl4O4S/c13-7-1-5(2-8(14)11(7)17)21(19,20)6-3-9(15)12(18)10(16)4-6/h1-4,17-18H

SMILES: c1c(cc(c(c1Cl)O)Cl)S(=O)(=O)c1cc(c(c(c1)Cl)O)Cl

Tetrachlorobisphenol S

CAS: 30609-79-1

Formula: C₁₂H₆Cl₄O₄S

Molecular weight: 388.04

Ref: 4Z-B-188005

Tetrachloro Biphenol S

Controlled Product

CAS: 30609-79-1

Applications Tetrachloro Biphenol S is an endocrine disruptor with estrogenic activity.
References Zheng, S., et al.; Water Res., 132, 167 (2018); Kuruto-Niwa, R., et al.: Environ. Toxicol. Pharmacol., 19, 121 (2005)

Formula: C₁₂H₆Cl₄O₄S

Color and Shape: Neat

Molecular weight: 388.05

Ref: TR-T889551