CAS 3061-93-6
:Alanyl-D-phenylalanine
Description:
Alanyl-D-phenylalanine, with the CAS number 3061-93-6, is a dipeptide composed of the amino acids alanine and D-phenylalanine. This compound features a peptide bond linking the carboxyl group of alanine to the amino group of D-phenylalanine. It is characterized by its potential biological activity, particularly in the context of neuropeptides and as a possible modulator of neurotransmitter systems. Alanyl-D-phenylalanine is known for its stability and solubility in water, making it suitable for various biochemical applications. The presence of the D-amino acid (D-phenylalanine) can influence its interaction with biological receptors and enzymes, distinguishing it from its L-counterpart. This dipeptide may also exhibit antioxidant properties and has been studied for its potential roles in pain management and mood enhancement. Overall, Alanyl-D-phenylalanine is a compound of interest in both pharmaceutical and nutritional research due to its unique structural and functional characteristics.
Formula:C12H16N2O3
InChI:InChI=1S/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10+/m0/s1
InChI key:InChIKey=OMNVYXHOSHNURL-WCBMZHEXSA-N
SMILES:C([C@@H](NC([C@H](C)N)=O)C(O)=O)C1=CC=CC=C1
Synonyms:- D-Phenylalanine, L-alanyl-
- L-Alanyl-D-phenylalanine
- Alanine, N-L-alanyl-3-phenyl-, D-
- D-Phenylalanine, N-L-alanyl-
- Alanyl-D-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Ala-D-Phe-OH
CAS:L-phenylalanine is an essential amino acid found in proteins that is the precursor for the neurotransmitter dopamine. The synthesis of L-phenylalanine from its precursor L-tyrosine is catalyzed by phenylalanine hydroxylase. Phenylalanine can also be synthesized from aspartic acid, but this reaction is not as efficient. L-phenylalanine can be efficiently transferred into the cytosol and converted to L-tyrosine, which has been shown to have a high specificity for dopaminergic neurons in rat brain tissue. The uptake of L-phenylalanine into cells through a process called active transport relies on the interaction between protonated L-phenylalanine or other positively charged molecules and chloride ions, which are found in cell membranes. This mechanism allows for efficient uptake of L-phenylalanine by cells without the need for energy expenditure.Formula:C12H16N2O3Purity:Min. 95%Molecular weight:236.27 g/mol

