CAS 30614-77-8
:3,4-Diethyl 3,4-furandicarboxylate
Description:
3,4-Diethyl 3,4-furandicarboxylate is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features two ethyl ester groups attached to the 3 and 4 positions of the furan ring, along with two carboxylate groups at the same positions, making it a diester derivative of furandicarboxylic acid. It is typically a colorless to pale yellow liquid with a pleasant odor. The presence of the ethyl groups enhances its solubility in organic solvents, while the carboxylate groups contribute to its reactivity, particularly in esterification and polymerization reactions. This compound is of interest in the field of green chemistry and materials science, as it can serve as a building block for biodegradable polymers and other sustainable materials. Its potential applications include use in the synthesis of various chemical intermediates and as a precursor for bio-based polymers. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H12O5
InChI:InChI=1S/C10H12O5/c1-3-14-9(11)7-5-13-6-8(7)10(12)15-4-2/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=ZODFWNHYQARJLC-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(OCC)=O)=COC1
Synonyms:- 2,3-Bis(ethoxycarbonyl)furan
- 3,4-Bis(ethoxycarbonyl)furan
- 3,4-Diethyl 3,4-furandicarboxylate
- 3,4-Diethyl furan-3,4-dicarboxylate
- 3,4-Furandicarboxylic acid, 3,4-diethyl ester
- 3,4-Furandicarboxylic acid, diethyl ester
- Brn 0170398
- Diethyl furan-3,4-dicarboxylate
- Dimethyl-3,4-Furandicarboxylate
- Diethyl 3,4-furandicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Furandicarboxylic acid, 3,4-diethyl ester
CAS:Formula:C10H12O5Purity:95%Color and Shape:LiquidMolecular weight:212.1993Diethyl 3,4-furandicarboxylate
CAS:Diethyl 3,4-furandicarboxylate is a chemical compound that is used as an antiproliferative drug in cancer therapy. It is synthesized by the thermal isomerization of diethyl acetylenedicarboxylate. The product has been shown to inhibit the growth of human cancer cells and has antibacterial activity against Gram-positive bacteria. Diethyl 3,4-furandicarboxylate also inhibits the synthesis of DNA and RNA by binding to the enzyme ribonucleotide reductase. Its cytostatic effects are due to its ability to inhibit cellular proliferation by inhibiting protein synthesis.
Formula:C10H12O5Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:212.2 g/mol



