CAS 3062-14-4: H-Asp-Leu-OH
Description:H-Asp-Leu-OH, also known as Aspartyl-Leucine, is a dipeptide composed of the amino acids aspartic acid (Asp) and leucine (Leu). It is characterized by its specific sequence, where aspartic acid is linked to leucine through a peptide bond. This compound is typically found in various biological systems and can play a role in protein synthesis and metabolism. H-Asp-Leu-OH is soluble in water, which is a common property of many peptides, and it may exhibit biological activity, potentially influencing cellular processes. The presence of the aspartic acid moiety can impart acidic properties, while leucine contributes hydrophobic characteristics, affecting the overall behavior of the peptide in different environments. Additionally, this dipeptide can be involved in various biochemical pathways and may serve as a building block for larger proteins or peptides. Its CAS number, 3062-14-4, allows for precise identification in chemical databases and literature.
Formula:C10H18N2O5
InChI:InChI=1/C10H18N2O5/c1-5(2)3-7(10(16)17)12-9(15)6(11)4-8(13)14/h5-7H,3-4,11H2,1-2H3,(H,12,15)(H,13,14)(H,16,17)
- Synonyms:
- Alpha-Aspartylleucine
