CymitQuimica logo

CAS 3062-48-4

:

2-(2-ethoxyethoxy)aniline

Description:
2-(2-Ethoxyethoxy)aniline, with the CAS number 3062-48-4, is an organic compound that belongs to the class of anilines, which are characterized by the presence of an amino group attached to an aromatic ring. This particular compound features a substituted aniline structure, where the amino group is connected to a benzene ring, and it has a 2-(2-ethoxyethoxy) substituent that enhances its solubility and reactivity. The ethoxyethoxy group contributes to its ether-like properties, making it more hydrophilic compared to simple anilines. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is used in various applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. The presence of both ether and amine functional groups allows for diverse chemical reactivity, including nucleophilic substitution and coupling reactions. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-2-12-7-8-13-10-6-4-3-5-9(10)11/h3-6H,2,7-8,11H2,1H3
SMILES:CCOCCOc1ccccc1N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.