CAS 30636-90-9: (20S)-Protopanaxadiol
Description:(20S)-Protopanaxadiol is a triterpenoid saponin derived from ginseng, specifically from the Panax species. It is characterized by its steroid-like structure, which includes a tetracyclic framework. This compound is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and immunomodulatory effects. (20S)-Protopanaxadiol is often studied for its role in traditional medicine and its potential therapeutic applications, particularly in enhancing immune function and exhibiting anticancer properties. The substance is typically found in various ginseng extracts and is believed to contribute to the overall health benefits associated with ginseng consumption. Its solubility is generally low in water but can be dissolved in organic solvents, which is important for its extraction and formulation in herbal products. Additionally, (20S)-Protopanaxadiol's safety profile and efficacy are subjects of ongoing research, as scientists continue to explore its mechanisms of action and potential uses in modern medicine.
Formula:C30H52O3
InChI:InChI=1S/C30H52O3/c1-19(2)10-9-14-30(8,33)20-11-16-29(7)25(20)21(31)18-23-27(5)15-13-24(32)26(3,4)22(27)12-17-28(23,29)6/h10,20-25,31-33H,9,11-18H2,1-8H3/t20-,21+,22-,23+,24-,25-,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=PYXFVCFISTUSOO-HKUCOEKDSA-N
SMILES:OC1CC2C3(C)CCC(O)C(C)(C)C3CCC2(C)C4(C)CCC(C14)C(O)(C)CCC=C(C)C
- Synonyms:
- (3Beta,5Xi,12Beta,13Alpha,14Beta)-Lanost-24-Ene-3,12,20-Triol
- (3β,12β)-Dammar-24-ene-3,12,20-triol
- 20(S)-Appd
- 20-Epiprotopanaxadiol
- Dammar-24-Ene-3,12,20-Triol, (3Β,12Β)-
- Dammar-24-ene-3β,12β,20-triol
- (20S)-Protopanaxadiol
- PROTOPANAXDIOL
