CymitQuimica logo

CAS 306387-90-6

:

N-[2-[(3'R,7'aR)-3',6',10,11b-tetramethyl-3-oxo-spiro[1,2,4,6,6a,6b,7,8,11,11a-decahydrobenzo[i]fluorene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[4,5-b]pyridine]-4'-yl]ethyl]-6-(3-phenylpropanoylamino)hexanamide

Description:
The chemical substance N-[2-[(3'R,7'aR)-3',6',10,11b-tetramethyl-3-oxo-spiro[1,2,4,6,6a,6b,7,8,11,11a-decahydrobenzo[i]fluorene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[4,5-b]pyridine]-4'-yl]ethyl]-6-(3-phenylpropanoylamino)hexanamide, with CAS number 306387-90-6, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and stereocenters. This substance features a spirocyclic framework, indicative of its unique three-dimensional arrangement, which contributes to its potential biological activity. The presence of amide and ketone functional groups suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound's large hydrophobic regions, due to the tetramethyl and phenyl groups, may affect its interaction with biological membranes and receptors. Such structural characteristics often correlate with specific pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to elucidate its biological effects and potential applications.
Formula:C44H63N3O4
InChI:InChI=1/C44H63N3O4/c1-29-25-39-42(47(28-29)24-23-46-40(49)13-9-6-10-22-45-41(50)17-14-32-11-7-5-8-12-32)31(3)44(51-39)21-19-35-36-16-15-33-26-34(48)18-20-43(33,4)38(36)27-37(35)30(44)2/h5,7-8,11-12,15,29,31,35-36,38-39,42H,6,9-10,13-14,16-28H2,1-4H3,(H,45,50)(H,46,49)/t29?,31-,35?,36?,38?,39-,42?,43?,44?/m1/s1
SMILES:CC1C[C@@H]2C([C@@H](C)C3(CCC4C5CC=C6CC(=O)CCC6(C)C5CC4=C3C)O2)N(CCN=C(CCCCCN=C(CCc2ccccc2)O)O)C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.