CAS 30646-49-2: 2-amino-N-[(2R)-tetrahydrofuran-2-ylmethyl]benzamide

Description: 2-amino-N-[(2R)-tetrahydrofuran-2-ylmethyl]benzamide is a chemical compound characterized by its amine and amide functional groups, which contribute to its reactivity and solubility properties. The presence of the tetrahydrofuran moiety indicates that the compound has a cyclic ether structure, which can influence its conformational flexibility and interactions with biological targets. This compound is likely to exhibit polar characteristics due to the amino and carbonyl groups, making it soluble in polar solvents. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the benzamide group is often associated with bioactive compounds. The stereochemistry indicated by the (2R) configuration of the tetrahydrofuran ring may also play a crucial role in the compound's biological activity and binding affinity to specific receptors or enzymes. Overall, 2-amino-N-[(2R)-tetrahydrofuran-2-ylmethyl]benzamide represents a complex organic molecule with potential significance in various chemical and biological contexts.

Formula: C₁₂H₁₆N₂O₂

InChI: InChI=1/C12H16N2O2/c13-11-6-2-1-5-10(11)12(15)14-8-9-4-3-7-16-9/h1-2,5-6,9H,3-4,7-8,13H2,(H,14,15)/t9-/m1/s1

2-Amino-N-((tetrahydrofuran-2-yl)methyl)benzamide

CAS: 30646-49-2

• Formula: C₁₂H₁₆N₂O₂
• Molecular weight: 220.2676

2-Amino-N-(tetrahydrofuran-2-ylmethyl)benzamide hydrochloride

CAS: 30646-49-2

Please enquire for more information about 2-Amino-N-(tetrahydrofuran-2-ylmethyl)benzamide hydrochloride including the price, delivery time and more …

• Formula: C₁₂H₁₆N₂O₂
• Purity: Min. 95%
• Molecular weight: 220.27 g/mol