CAS 30648-81-8
:1,3-dimethylpiperidin-4-amine
Description:
1,3-Dimethylpiperidin-4-amine, with the CAS number 30648-81-8, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features two methyl groups attached to the first and third carbon atoms of the piperidine ring and an amino group at the fourth position. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. It is soluble in polar solvents, such as water and alcohols, due to its ability to form hydrogen bonds. 1,3-Dimethylpiperidin-4-amine is of interest in medicinal chemistry and may serve as a building block in the synthesis of pharmaceuticals and agrochemicals. However, handling this compound requires caution due to potential toxicity and the need for proper safety measures in laboratory settings.
Formula:C7H16N2
InChI:InChI=1/C7H16N2/c1-6-5-9(2)4-3-7(6)8/h6-7H,3-5,8H2,1-2H3
SMILES:CC1CN(C)CCC1N
Synonyms:- 1,3-Dimethylpiperidin-4-amin
- 4-Piperidinamine, 1,3-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
