CAS 3066-70-4
:2,3-Dibromopropyl methacrylate
Description:
2,3-Dibromopropyl methacrylate is an organic compound characterized by its methacrylate functional group and two bromine atoms attached to the propyl chain. It is typically a colorless to pale yellow liquid with a distinctive odor. This compound is known for its reactivity, particularly in polymerization processes, where it can serve as a monomer in the synthesis of various copolymers. The presence of bromine atoms enhances its ability to participate in radical polymerization, making it useful in producing materials with specific properties, such as increased thermal stability and flame retardancy. Additionally, 2,3-Dibromopropyl methacrylate exhibits moderate solubility in organic solvents, while being less soluble in water. Safety considerations are important when handling this compound, as it may pose health risks through inhalation or skin contact. Proper storage in a cool, dry place away from light is recommended to maintain its stability and prevent degradation. Overall, its unique chemical structure and reactivity make it valuable in various industrial applications, particularly in the field of polymer chemistry.
Formula:C7H10Br2O2
InChI:InChI=1S/C7H10Br2O2/c1-5(2)7(10)11-4-6(9)3-8/h6H,1,3-4H2,2H3
InChI key:InChIKey=SOFCUHQPMOGPQX-UHFFFAOYSA-N
SMILES:O(CC(CBr)Br)C(C(C)=C)=O
Synonyms:- 1-Propanol, 2,3-dibromo-, methacrylate
- 2,3-Dibromopropyl methacrylate
- 2-Propenoic acid, 2-methyl-, 2,3-dibromopropyl ester
- Methacrylic acid, 2,3-dibromopropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
