CAS 3066-86-2
:5-Bromocytidine
Description:
5-Bromocytidine is a nucleoside analog characterized by the presence of a bromine atom at the 5-position of the pyrimidine ring of cytidine. This modification can influence its biological activity, particularly in the context of nucleic acid metabolism and interactions with nucleic acid synthesis enzymes. The molecular structure of 5-Bromocytidine consists of a pyrimidine base (5-bromouracil) linked to a ribose sugar, which is typical of nucleosides. It is soluble in water and exhibits properties that allow it to participate in various biochemical reactions, making it of interest in research, particularly in studies related to DNA and RNA synthesis, as well as in the development of antiviral and anticancer agents. The compound's bromine substitution can also affect its hydrogen bonding capabilities and stability, potentially impacting its incorporation into nucleic acids. As a chemical entity, 5-Bromocytidine is utilized in various laboratory settings for its unique properties and potential therapeutic applications.
Formula:C9H12BrN3O5
InChI:InChI=1S/C9H12BrN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6-,8-/m1/s1
InChI key:InChIKey=HRDXGYQCVPZEJE-UAKXSSHOSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)N=C(N)C(Br)=C2
Synonyms:- Cytidine, 5-bromo-
- 5-Bromocytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Bromocytidine
CAS:Formula:C9H12BrN3O5Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:322.125-Bromocytidine
CAS:5-Bromocytidine is a nucleoside analog that is a key disinfection by-product of drinking water and may interfere with nucleic acid synthesis.Formula:C9H12BrN3O5Purity:99.63%Color and Shape:SolidMolecular weight:322.115-Bromocytidine
CAS:5-Bromocytidine is a pyrimidine nucleoside that has been shown to inhibit the replication of influenza virus in cell culture. It stabilizes the ribonucleotide reductase enzyme, which is responsible for converting ribonucleosides to deoxyribonucleosides. This inhibition prevents the production of viral RNA and protein synthesis, leading to inhibition of viral growth. 5-Bromocytidine has also been shown to have antiviral effects against HIV and herpes simplex virus type 1 (HSV1) in cell cultures.Formula:C9H12BrN3O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:322.11 g/mol






