CAS 3066-86-2: 5-Bromocytidine
Description:5-Bromocytidine is a nucleoside analog characterized by the presence of a bromine atom at the 5-position of the pyrimidine ring of cytidine. This modification can influence its biological activity, particularly in the context of nucleic acid metabolism and interactions with nucleic acid synthesis enzymes. The molecular structure of 5-Bromocytidine consists of a pyrimidine base (5-bromouracil) linked to a ribose sugar, which is typical of nucleosides. It is soluble in water and exhibits properties that allow it to participate in various biochemical reactions, making it of interest in research, particularly in studies related to DNA and RNA synthesis, as well as in the development of antiviral and anticancer agents. The compound's bromine substitution can also affect its hydrogen bonding capabilities and stability, potentially impacting its incorporation into nucleic acids. As a chemical entity, 5-Bromocytidine is utilized in various laboratory settings for its unique properties and potential therapeutic applications.
Formula:C9H12BrN3O5
InChI:InChI=1S/C9H12BrN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6-,8-/m1/s1
InChI key:InChIKey=HRDXGYQCVPZEJE-UAKXSSHOSA-N
SMILES:O=C1N=C(N)C(Br)=CN1C2OC(CO)C(O)C2O
- Synonyms:
- Cytidine, 5-bromo-
- 5-Bromocytidine
