CAS 3067-13-8
:Benzo[a]pyrene-1,6-dione
Description:
Benzo[a]pyrene-1,6-dione is a polycyclic aromatic compound characterized by its fused ring structure, which includes a dione functional group. This compound is derived from benzo[a]pyrene, a well-known carcinogen, and exhibits significant chemical reactivity due to the presence of the carbonyl groups. It is typically a solid at room temperature and is insoluble in water but soluble in organic solvents. The presence of the dione functional groups contributes to its potential as an electrophile, making it reactive in various chemical reactions, including nucleophilic additions. Benzo[a]pyrene-1,6-dione is of interest in environmental chemistry due to its formation from the degradation of polycyclic aromatic hydrocarbons (PAHs) and its implications in toxicology and carcinogenesis. Its study is crucial for understanding the mechanisms of PAH-related health risks and environmental persistence. Additionally, it may serve as a precursor or intermediate in synthetic organic chemistry, particularly in the development of more complex molecular architectures.
Formula:C20H10O2
InChI:InChI=1S/C20H10O2/c21-17-10-6-11-5-7-16-19-13(8-9-15(17)18(11)19)12-3-1-2-4-14(12)20(16)22/h1-10H
InChI key:InChIKey=OXWHZARNAGLRFL-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C4C(=CC=C3C=5C1=CC=CC5)C(=O)C=CC4=CC2
Synonyms:- 1,6-Dihydrobenzo[a]pyrene-1,6-dione
- Benzo[A]Pyrene-1,6-Dione
- Benzo[a]pyrene-1,6-quinone
- NSC 30985
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzo[a]pyrene-1,6-quinone
CAS:Controlled Product<p>Applications Benzo[a]pyrene-1,6-quinone is a metabolite of Benzopyrene (B205800) and is able to induce epidermal growth factor receptor (EGFR) cell signaling in human mammary epithelial cells. Also highly mutagenic and carcinogenic.<br>References Rodriguez-Fragoso, L., et al.: Toxicol. Appl. Pharm., 235, 321 (2009); Sen, S., et al.: Chem. Res. Toxicol., 25, 2117 (2012)<br></p>Formula:C20H10O2Color and Shape:NeatMolecular weight:282.29

